Answered: 2. Draw a reaction mechanism to explain…

Science

Chemistry

2. Draw a reaction mechanism to explain the following reaction. OH (aq) LOH i. OH

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter7: Alkynes

Section: Chapter Questions

Problem 7.10P: Complete each acid-base reaction and predict whether the position of equilibrium lies toward the...

See similar textbooks

Related questions

Q: Telluric acid, H6TeO6 is a diprotic acid with Ka₁ = 2.1×10-8 and Ka2 = 1.0x10-11, Determine the pH…

A: The objective of this question is to calculate the pH of a 0.35e-2 mol/L aqueous solution of…

Q: What is the major organic product of the following reaction? i 1. CH,MgBr 2. H₂O O Only III O Only I…

A: -> Grignard reagent has nucleophilic character hence it can give nucleophilic addition reaction…

Q: Explain the uniqueness existence of the observed product(why the desired product didn't form). Go…

A: The product formed is due to the reducing group of lithium aluminum hydride. Being a very strong…

Q: 11. Complete the three following multi-step reactions involving either aldol or Knoevenagel…

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: analyse this ir spectrum

A: The detailed ans has been attached. Explanation:3033 cm^-1: Likely due to sp^2 C-H stretching…

Q: 2. What dicarbonyl compounds forms the molecules below upon treatment with catalytic NaOCH¸ in HOCH¸…

A: Given reaction is an example of nucleophilic addition-elimination reaction of dicarbonyl…

Q: When writing the mass action expressions (K=...), the concentration of products are always written…

A: The mass action expression is an equation that shows the ratio of concentration or active mass of…

Q: - chemical engineer is studying the following reaction: CH4(9)+2H2S(9) → CS2(9)+4H2(g) t the…

A: The direction in which the reaction proceeds to reach equilibrium can be predicted by determining…

Q: 人 NH2NH2, TSOH a

A: Given:We have to find the product of the reaction

Q: A chemical engineer is studying the following reaction: HCH,CO2(aq)+CH,NH2(aq) →CH,CO₂(aq)+CH, NH…

A: The given reaction is :Predict the change in the composition of concentration.

Q: Which of the following compounds would most likely undergo alpha cleavage in a mass spectrometer? HO

A: The objective is to determine the compound which most likely to undergo alpha cleavage in a mass…

Q: 0 State what rate law you would expect from this mechanism (Rate = k[Acetone]"[H*]"[[₂]') • Compare…

A: The objective of the question is to determine the rate law from the given reaction mechanism and…

Q: Shown below is the major resonance structure for a molecule. Draw the second best resonance…

Q: Please tell me where can you get the double bond That is beside the N-H ? ? ? ? ? ? ? not the upper…

A: In a given reaction 3-aminopropanenitrile reacts with anhydride. The reaction includes the following…

Q: Practice in Synthesis OH OH + enantiomer

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: Calculate the amount of granulated agar needed to make 1.5% agar medium and enter it into Table 1.…

A: The mass by volume percent of a solution can be calculated using the following equation-…

Q: find the ph of: 0.15M phenylamine, C6H5NH2, pKb = 9.33

A: The objective of the question is to calculate the pH of a 0.15M solution of phenylamine, a weak…

Q: For the reaction below, Kc = 0.60 at 550 K. The reaction starts with a 0.050 M concentration of…

A: An equilibrium state generally arises in systems when both the formation of products from reactants…

Q: Draw the structure for (S)-2,5-dimethylhept-3-yne.

Q: What are reactants will form the enamine shown? N OH Ѣ CH3CH2NHCH3 CH3CH2NHCH H2SO4 H₂SO4 CHỊCHÍNH…

A: Enamines are organic compounds that contain a nitrogen atom with a double bond to a carbon atom,…

Q: 9. Provide a mechanism for the following reaction and rationalise the reactivity in terms of the 3…

A: The objective of the question is to provide a mechanism for the given reaction and explain the…

Q: A 46.4 mL sample of a 0.328 M aqueous acetic acid solution is titrated with a 0.235 M aqueous barium…

A: Given,molarity of acetic acid ( CH3COOH ) = 0.328 Mvolume of CH3COOH = 46.4 mLmolarity of barium…

Q: Select the major product of the following reactions. 1. equ. NBS/heat/ CCI 2. tert-butoxide -Br గగన…

A: NBS/CCl4/heat performs the allylic bromination of a compound. We can see that only one place is…

Q: Predict the MAJOR product of the following reactions: a. b. 1) NaOEt/ EtOH 2) Br 3) NaOEt/ EtOH ΕΙΟ…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: Question 4. Methylvinyl ketone (MVK) can undergo a polymerization reaction in the presence of AIBN…

A: The objective of the question is to understand the mechanism of the polymerization reaction of…

Q: A student conducted the Gravimetric Analysis of Phosphorus in Fertilizer experiment. The student use…

A: In gravimetric analysis, the P in P2O5 is precipitated according to the below reaction. HPO42-(aq) +…

Q: Which of the following is an isoelectronic series? O Ba, Al, Na, l- O Ba, O, Al, Na, O F, Na+, Al3+,…

A: Since,Isoelectronic species are those species that have the same number of electrons.Therefore,

Q: What are the steps and reagents needed to synthesize this molecule?

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: What is the predicted product of the reaction shown? excess CH3CH2SH Raney H2SO4 Ni A) B) OH ☎ D) E)

A: The objective is to determine the product formed by the given reaction. Ketone on reaction with…

Q: Predict the major products of the following organic reaction: CN Some important notes: •Draw the…

A: The objective is to determine the product formed by the given reaction. The reaction of diene with…

Q: Consider the following reaction: 2 H2O(g) + 2 SO2(g) 2 H2S(g) + 302(g) A reaction mixture initially…

A: The balanced chemical equation is given below.

Q: Draw the simplest set of curved arrows that shows how the structure on the left could be turned into…

A: Resonance:Resonance is a phenomenon by which a compound or ion can be represented by two or more…

Q: Many household cleaning products contain oxalic acid, H2C2O4, a diprotic acid with the following…

A: Given ,

Q: Predict the product(s) of the following reaction.

A: Olefin metathesis reactions are reactions in which two olefins rearrange to form a new alkene. These…

Q: A system at equilibrium contains 12 (g) at a pressure of 0.27 bar and I(g) at a pressure of 0.26…

A: The objective of the question is to find the pressure of I2 when the system returns to equilibrium…

Q: To identify a diatomic gas (X2), a researcher carried out the following experiment: She weighed an…

A: Using the ideal gas equation, we can calculate the molar mass of the diatomic gas.The ideal gas…

Q: At-13.7 °C the concentration equilibrium constant K = 2.0 × 10 for a certain reaction. Here are some…

A: Answer:Value of equilibrium constant changes with change in temperature. Whether it will increase or…

Q: Draw structural formulas for the a,ẞ-unsaturated aldehyde or ketone and the lithium diorganocuprate…

A: Organocuprates (Gilman reagents) are excellent nucleophiles for C-C bond formation. The most…

Q: A local FM radio station broadcasts at a frequency of 90.7 MHz. Calculate the wavelength at which it…

A: Given that,The frequency of the FM radio stattion,As we know that,Then,Wavelength = ?

Q: Please don't provide hand writtin solution..... I need explation and step solution.....

A: The initial pressure of acetaldehyde was 607 mmHg (answer is in 3 significant figures).…

Q: OCH 3 curcumin yellow food coloring from Curcum H3CO HO OH

A: The objective of the question is to find the possible tautomers of the given structure of…

Q: Consider the following reactions: SO32 (aq) + H2O(l) = HSO3(aq) + OH(aq) HSO3(aq) + H2O(l) =…

A: The question is based on the concept of the pH of the solution.It is defined as a negative logarithm…

Q: 13. Hydroxyapatite is the main mineral component of bone. How many grams of hydroxyapatite will…

Q: Br structure name CI F Cl Br LL F Br ☐ Br ☐

A: The given structures are:Identify IUPAC name.The IUPAC (International Union of Pure and Applied…

Q: Consider the following reaction, equilibrium concentrations, and equilibrium constant at a…

Q: H Part 1 of 2 Praw the structure of the diene used to prepare the given compound. Show relevant…

A: The objective of the question is to predict the structure of diene for the following molecule given.

Q: ← Problem 45 of 52 Submit Draw the major product of this reaction. Ignore inorganic byproducts and…

A: The objective is to determine the product formed by the given reaction. anhydride on reaction with…

Q: T 5.5 75 4.85 5.0 7.5 7.0 4.86 4.5 2.04 4.0 C10H12O2 3.5 3.0 (c) 7.0 6.5 6.0 0.97 2.05 C10H12O2 5.5…

A: 1 ) NMR spectrum of C10H12O2 :At 4.25 ppm, a 2H signal is observed which is influenced by an…

Q: A certain weak base has a K₁ of 7.90 × 10-7. What concentration of this base will produce a pH of…

A: The objective of this question is to find the concentration of a weak base that will produce a…

Q: Which of the following is a secondary alkyl halide? (CH3)2CHBr CH3Br (CH3)2CHCH2Br all of these are…

A: The objective is to determine the secondary alkyl halide from the given options. Secondary alkyl…

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

2. Draw a reaction mechanism to explain the following reaction.
O
OH
i.
OH (aq)
LOH

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Interpretation of reaction

VIEW

Step 2: Mechanism of reaction

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Complete the following reactions by filling in any missing reactants, reagents or products. a) Zn(Hg) conc. HCl b) ОН ? с) ОН РСС CH,Cl,
Which of the following reactions are correct? Explain the answer. + H₂O + H₂O H₂SO4 H OH H OH
Draw the products of the reaction and explan the process or mechanism. 1. H2SO4 НО H. loss of H2O 2. CH,CH2 H Acid catalyst C=C H H
1. MeOH (1 eq), H* 2. nBuOH (1 eq), H*
left 4. Consider the following equilibrium: 29925610 + Aga weak and Sung base Bast CORS + 1ght base: Strong ad d AddOH ress stable OH Is the carboxylate anion (CH3CH₂COO) an appropriate base to deprotonate the alcohol? A) yes, because the equilibrium favors the left side B) yes, because the equilibrium favors the right side C) no, because the equilibrium favors the left side D) no, because the equilibrium favors the right side OH COO bas
What is the major product of the following reaction? OH oc | (1) BH3 (2) H₂O₂, OH-
Complete the reaction map by matching A-E with the given choices. H2 H2 B E Pt Cla Na in lig NH3 он + но Match each item to a choice A
4. Please write the type of reaction each equation represents (elimination, addition, rearrangement, substitution). Write your answers beneath each reaction. HNE Pd catatlyst HyC NaCN NE acid cat NC "OH CH Lewis acid Me base UV ight
1. Draw the product(s) for each of the following reactions following an acidic workup where necessary: NaBH, Ph CHo HC CH CH,CH,NH, OCH,CH, CH;NHNH,
Identify the best conditions to complete the SN2 reaction shown below. CI A) NaN, DMSO B) NaCN, ETOH C) NaCN, acetonitrile D) NaNH2, acetonitrile CN E) LİCI, THF
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
The key step in a reported laboratory synthesis of sativene, a hydrocarbon isolated from the mold Helminthosporium sativum, involves the following base treatment of a keto tosylate. What kind of reaction is occurring? How would you complete the synthesis?