3. Potassium metal and water react to form potassium hydroxide and hydrogen gas. If you react 1.12 g of potassium metal and 15.0 mL of water (density = 0.99997 g/mL), answer the following questions below: Write a balanced chemical equation. b. Which reactant is the limiting reagent? C. How many grams of potassium hydroxide are formed?

3. Potassium metal and water react to form potassium hydroxide and hydrogen gas. If you react 1.12 g of potassium metal and 15.0 mL of water (density = 0.99997 g/mL), answer the following questions below: Write a balanced chemical equation. b. Which reactant is the limiting reagent? C. How many grams of potassium hydroxide are formed?

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

ou know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to know to determine the amount of product that will be produced? Explain.
Outline the steps needed to determine the limiting reactant when 30.0 g of propane, C3H8, is burned with 75.0 g of oxygen. Determine the limiting reactant.
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
You know that chemical A reacts with chemical B. You react 10.0 g A with 10.0 g B. What information do you need to determine the amount of product that will be produced? Explain.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
Explain how one determines which reactant in a process is the limiting reactant. Does this depend only on the masses of the reactant present? Give an example of how to determine the limiting reactant by using a Before-Change-After (RCA) table with a balanced chemical equation and reactant starling amounts.
Although many sulfate salts are soluble in water, calcium sulfate is not (Table 7. 1). Therefore, a solution of calcium chloride will react with sodium sulfate solution to produce a precipitate of calcium sulfate. The balanced equation is :math>CaCl2(aq)+Na2SO4(aq)CaSO4(s)+2NaCl(aq) a solution containing 5.21 g of calcium chloride is combined with a solution containing 4.95 g of sodium sulfate, which is the limiting reactant? Which reactant is present in excess?
What is the theoretical yield for a reaction, and how does this quantity depend on the limiting reactant?
For each of the following unbalanced chemical equations, suppose exactly 5.0 g of each reactant is taken. Determine which reactant is limiting, and calculate what mass of each product is expected, assuming that the limiting reactant is completely consumed. msp;Na(s)+Br2(l)NaBr(s) msp;Zn(s)+CuSO4(aq)ZnSO4(aq)+Cu(s) msp;NH4Cl(aq)+NaOH(aq)NH3(g)+H2O(l)+NaCl(aq) msp;Fe2O3(s)+CO(g)Fe(s)+CO2(g)
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.