31. Given the following reaction determine Free Energy change and E°call for the following reaction at standard conditions? Is this reaction spontaneous? Mn? leg) + Ks) = MnO2 (5) +K *teg) (acidic) a. -800 kJ/non spontaneous c. 800 kJ/non spontaneous e. -400 kJ/non spontaneous g. 400 kJ/non spontaneous b. -800 kJ/spontaneous d. 800 kJ/spontaneous f. -400 kJ/spontaneous h. 400 kJ/spontaneous

31. Given the following reaction determine Free Energy change and E°call for the following reaction at standard conditions? Is this reaction spontaneous? Mn? leg) + Ks) = MnO2 (5) +K *teg) (acidic) a. -800 kJ/non spontaneous c. 800 kJ/non spontaneous e. -400 kJ/non spontaneous g. 400 kJ/non spontaneous b. -800 kJ/spontaneous d. 800 kJ/spontaneous f. -400 kJ/spontaneous h. 400 kJ/spontaneous

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.95QE

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
Calculate the standard cell potential of the following cell at 25C. Cr(s)Cr3(aq)Hg22(aq)Hg(l)
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?
Consider a cell in which the reaction is 2Ag(s)+Cu2+(aq)2Ag+(aq)+Cu(s) (a) Calculate E° for this cell. (b) Chloride ions are added to the Ag|Ag+ half-cell to precipitate AgCl. The measured voltage is +0.060 V. Taking [Cu2+]=1.0M, calculate [Ag+]. (c) Taking [Cl-] in (b) to be 0.10 M, calculate Kspof AgCl.
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?