Bromine monochloride is synthesized using the reactionBr₂(g) + Cl₂(g)A 210.0 L flask initially contains 0.959 kg of Br, and 1.161 kg of Cl₂. Calculate the mass of BrCl, in grams, that is present inthe reaction mixture at equilibrium. Assume ideal gas behavior.mass of BrCl2 BrCl(g) Kp 1.1 x 104 at 150 K=What is the percent yield of BrCI?percent yield:

Answered: Image /qna-images/answer/3a555770-d290-4dfc-9e97-02a4bf667cec.jpg

Bromine monochloride is synthesized using the reaction Br₂(g) + Cl₂(g) 2 BrCl(g) Kp 1.1 x 104 at 150 K A 210.0 L. flask initially contains 0.959 kg of Br, and 1.161 kg of Cl,. Calculate the mass of BrCI, in grams, that is present in the reaction mixture at equilibrium. Assume ideal gas behavior. mass of BrCl: What is the percent yield of BrCl? percent yield:

Bromine monochloride is synthesized using the reaction Br₂(g) + Cl₂(g) 2 BrCl(g) Kp 1.1 x 104 at 150 K A 210.0 L. flask initially contains 0.959 kg of Br, and 1.161 kg of Cl,. Calculate the mass of BrCI, in grams, that is present in the reaction mixture at equilibrium. Assume ideal gas behavior. mass of BrCl: What is the percent yield of BrCl? percent yield:

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 12.36PAE: The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of...

See similar textbooks

Similar questions

Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?
Write an equation for an equilibrium system that would lead to the following expressions (ac) for K. (a) K=(Pco)2 (PH2)5(PC2H6)(PH2O)2 (b) K=(PNH3)4 (PO2)5(PNO)4 (PH2O)6 (c) K=[ ClO3 ]2 [ Mn2+ ]2(Pcl2)[ MNO4 ]2 [ H+ ]4 ; liquid water is a product
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Explain that equilibrium is dynamic, and that at equilibrium the forward and backward reaction rates are equal.
A 1.00-L flask was filled with 2.00 moles of gaseous SO2 and 2.00 moles of gaseous NO2 and heated. After equilibrium was reached, it was found that 1.30 moles of gaseous NO was present. Assume that the reaction SO2(g)+NO2(g)SO3(g)+NO(g) occurs under these conditions. Calculate the value of the equilibrium constant, K, for this reaction.