Determine the pH of a 0.774556 M C6H5CO2H M solution if the Ka of C6H5CO2H is 6.5 x 10-5.

Answered: Determine the pH

Science

Chemistry

Determine the pH

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter14: Acids And Bases

Section: Chapter Questions

Problem 30QRT

See similar textbooks

Related questions

Q: Calculate the ph of 1.55 M CH3NH2. The Kb for CH3NH2= 4.4 x 10^-4

Q: Calculate the pH of a 0.40 M solution of(C2H5)2NH (Kb=1.3x10^-3)

Q: What is the pH of a 0.710 M solution of C5H5NHB (Kb of C5H5N is 1.7 x 10-9)?

A: pH is used to determine the concentration of hydronium ion.

Q: Calculate the pH of a 0.025 M solution of propanoic acid (Ka = 1.3 x 10-5). The answer is 1.6

Q: The pH of a solution for which [OH-] = 1.0 x10-6 is %3D

A: pH stands for Hydrogen potentials. pH is a negative logarithm of the concentration of hydrogen ions.…

Q: Find the pH of a 0.15 M solution of ammonia, NH3. Kb = 1.8 X 10-5

Q: Calculate the pH of a 0.060 M solution of benzoic acid (C6H5CO2H) given that Ka = 6.3×10-5 for the…

A: Given: Molarity of benzoic acid is 0.060 M Ka is 6.3×10-5

Q: Calculate the pH of a 0.350 M solution of benzoic acid. Benzoic acid is a weak monoprotic acid with…

Q: Calculate the pH of a .10 M solution of formic acid (HCHO2). The Ka of formic acid is 1.8 x 10-4.

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: What is the pH of a 0.650 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

Q: Calculate pH for 0.0750 M C5H5NHCl (Ka=5.90 * 10^-6 for C5H5NH)

Q: Determine the pH of each of the following solutions. (a) 0.762 M hypobromous acid (weak acid…

A: Here, we have to calculate the pH of the given solutions: 0.762 M hypobromous acid (weak acid with…

Q: what is the ph of a 0.85 M solution of pyridine (C5H5N, Kb = 1.70 x 10 ^-9)

A: Pyridine is a weak base. pOH of a weak base. pOH = -log [OH-] pH = 14 - pOH For a weak base like…

Q: Calculate the pH of a 0.315 M solution of propanoic acid, for which the Ka value is 1.30 x 10-5.

Q: Calculate the pH of a 0.350M aqueous solution of NH3 , The Kb of NH3 is 1.77 x 10-5

A: Given: The concentration of aqueous NH3=0.350M

Q: Galaulate the PH and the Pott FOR 9.6M solution OF MH₂ инз K. FOR NH3=1.97105

A: Here we are required to find the pOH and pH of 0.6M of ammonia solution

Q: What is the pH of 0.836 M anilinium hydrochloride (C6H5NH3CL) solution in water, given that Kb for…

A: An acid is a substance that gives H+ ions in its solution whereas a basic substance gives OH- ions…

Q: Calculate the pH of a 0.20 M solution of sodium acetate (NaCH3COO) given that the Ka of acetic acid…

Q: What is the pH of a solution that has [H3O+] = 6×10^-12?

A: The pH of a solution is calculated as the negative logarithm of hydronium ion concentration and is…

Q: Calculate the pH of a 0.0153 M aqueous solution of formic acid (HCOOH, Ka = 1.8×10-4)

Q: Calculate the pH of a 0.60 M solution of ethylamine(C2H5NH2, Kb = 5.6 x 10-4.)

Q: Find the pH and percent ionization of a 0.200 M HNO2 solution Ka of HNO2= 4.6 x 010-4

Q: What is the concentration of a solution of Ca1OH22 for which the pH is 11.68?

A: Ca ( OH)2 ------> Ca + 2 OH - pOH = 14 - 11.68 = 2.32 pOH = - log [ OH-] 2.32 = - log [OH-] [OH-]…

Q: What is the pH of a 0.0580 M solution of hydrocyanic acid, HCN (Ka = 4.9 × 10-1º)?

Q: Calculate the pH of 0.045 C5H5N (Pyridine) K_b= 1.7 x 10^-9 for C5H5N

A: We will ionize pyridine , then draw ICE table to calculate pH of solution.

Q: What is the pH of a 0.430 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

A: pH= 1/2(pKb-logc) Here given Kb=1.7×10-9,hence pKb=-logKb=-log(1.7×10-9) given c=0.430 M

Q: What is the pH of a 0.0310 M solution of hydrocyanic acid, HCN (Ka = 4.9 x 10-10)?

A: Answer:- This question is answered by using the simple concept of calculation of pH of weak acid…

Q: Calculate the pH of a 0.0101 M aqueous solution of formic acid (HCOOH, Ka = 1.8E-4). pH =

A: For weak monoprotic acid ( HCOOH) : pH = 0.5 x (- log Ka - log C ) pH = 0.5 x ( - log 1.8 x 10-4 -…

Q: What is the pH of a 0.0360 M solution of hydrocyanic acid, HCN (Ka = 4.9 x 10-10)?

Q: What is the pH of a 0.660 M solution of C3H;NHB (Kb of C5H5N is 1.7 x 10-9)?

A: Given information, [C5H5NHBr] = 0.660 M Kb of C5H5N = 1.7*10-9 Calculate: pH = ?

Q: 3. Calculate the pH of a 0.400 M KC2H3O2 (Ka for HC2H3O2 is 1.8 x 10-5)

A: In this question we have to tell the PH of the solution.

Q: What is the pH of a 0.380 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

Q: Calculate the pH of a 0.236 M solution of a triprotic weak acid, H3A, given the acid ionization…

A: Given, The pH of a 0.236 M solution of a triprotic weak acid, H3A is: the acid ionization…

Q: Calculate the pH of a 0.424 M aqueous solution of hydrocyanic acid (HCN, Ka = 4.0×10-10).

A: pH of the solution can be calculated by using the formula, pH = [H+]. Given data, Concentration of…

Q: Determine the hydroxide ion concentration and pH of 0.0942 M hypochlorous acid solution. Ka = 2.85 x…

A: Concentration of hypochlorous acid (HOCl) solution = 0.0942 M Ka of HOCl = 2.85 * 10-8

Q: What is the pH of a 0.15M solution of potassium nitrate? (The Ka value for nitrous acid is 4.0 x…

A: Considering the given solution to be 0.15 M potassium nitrite, we have solved further.

Q: Find the pH of a 0.600 M solution of methylamine CH3NH2. Kb = 4.4 x 10-4. %3D

A: Given,Concentration of methylamine = 0.600M.Kb = 4.4*10-4.

Q: Calculate the pH of a 0.500 M aqueous solution of HCOOH. ka = 1.77 x 10-4

A: HCOOH is a weak acid which undergoes partial dissociation in aqueous condition with degree of…

Q: What is Ka for the conjugate acid of C₅H₅N (Kb = 1.7 × 10⁻⁹)?

A: Kw is ionization constant for water . Ka and kB ionization constant for Acid and base respectively…

Q: What is the pH of a 0.500 M solution of C₅H₅NHBr (Kb of C₅H₅N is 1.7 × 10⁻⁹)?

Q: Determine the Ph of a 0.020 M solution of oxalic acid, H2C2O4. What is the concentration of C2O4 ion…

A: Oxalic acid is diprotic acid and Ka1 = 6.5 * 10-2 and Ka2 = 6.1 * 10-5 [Oxalic acid] = 0.020 M…

Q: What is the pH of a 0.0680 M solution of hydrocyanic acid, HCN (Ка %3D 4.9 х 10-10)?

Q: What determines the strength of an acid? Calulate the pH of each of the following: 0.05M HCl 0.06M…

A: The strength of an acid is determined by the factor that how many H+ ion get dissociated from the…

Q: Determine the pH of a 0.461 M C6H5CO2H M solution if the Ka of C6H5CO2H is 6.5 x 10-5.

A: Given,Concentration = 0.461M.Ka = 6.5×10-5Then,

Q: Calcualtw the pH of a 0.217 M HC7H5O2 aqueous solution. Ka for HC7H5O2 is 6.5 x 10^-5.

A: pH of an acid is equal to negative logarithm of concentration of H+ ions.

Q: Calculate the pH of a 0.05 mol dm3 CH;COOH solution: the dissociation constant Ka for CH;COOH is…

A: An acid which will not dissociate completely to furnish hydrogen ion is called weak acid

Q: Determine the pH of a 0.24 M solution of sodium acetate (CH3COONa) at 25°C.(Ka of acetic acid = 1.8…

A: Equation for the ionization of CH3COONa is: [CH3COONa] is 0.24 M. It implies 0.24 mols of CH3COONa…

Q: Calculate the pH of a 0.0555 M aqueous solution of the weak base ethylamine (C2H5NH2, Kb =…

A: For C2H5NH2 , Kb = 4.30 × 10-4 C2H5NH2 + H2O ⇌ C2H5NH3+ + OH- Kb = [C2H5NH3+] [OH-] / [C2H5NH2]…

Concept explainers

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red.

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.

Question

Determine the pH of a 0.774556 M C₆H₅CO₂H M solution if the K_a of C₆H₅CO₂H is 6.5 x 10^-5.

Expert Solution

Step 1

The scale which is used to analyze the acidity and basicity of an aqueous solution is called as pH scale. The pH value is 0 to 14 where 7 indicates it is neutral and value below 7 is acidic and whereas above 7 is basic.

Step 2

Given:

C=0.774556 M

Ka= 6.5 x 10^-5.

Formula used:

ka= $\frac{{[H^{+}]}^{2}}{C - [H^{+}]}$

pH=-log[H⁺]

Step by step

Solved in 4 steps

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is the pH of a 0.349 M C6H5CO2H M solution if the Ka of C6H5CO2H is 6.5 x 10-5?
What is the pH of a 0.190 M C6H5CO₂H M solution if the K₂ of C6H5CO₂H is 6.5 x 10-5?
What is the pH of a 0.20 M solution of CH3NH3NO3 at 25 °C? At this temperature, the K₁ for CH3NH₂ is 4.4 x 10-4 and the Ka for HNO3 is 2.4.
Calculate the pH of a 0.591 M aqueous solution of benzoic acid (C6H₂COOH, K₂ = 6.3x10-5). pH =
Calculate the pH of a .10 M solution of formic acid (HCHO2). The Ka of formic acid is 1.8 x 10-4.
(f) Calculate the pH of the following solutions: (i) A 0.045 M solution of sulphuric acid. (ii) A solution containing 0.4 g sodium hydroxide in 100 cm³ water. (iii) Given the Ka value for CH3COOH is 1.8 x 10-5, calculate the pH of the acid. The initial concentration of the acid is 0.2 M
Hydrazine, N2H4, has Kb = 1.3E-6. Calculate the pH of a 0.644 M solution of N2H4.
COHSOH(ag) + H2On + CeHsO (aq) + H3O*(a9) Ka= 1.12 x 10-10 (a) Phenol is a weak acid that partially dissociates in water according to the equation above. Write the equilibrium-constant expression for the dissociation of the acid in water. (b) What is the pH of a 0.75 M CaHsOH(ag) solution? (C) For a certain reaction involving CaHsOH(ag) to proceed at a significant rate, the phenol must be primarily in its deprotonated form, C3H5O (eg). In order to ensure that the CsHsOH(aq) is deprotonated, the reaction must be conducted in a buffered solution. On the number scale below, circle each pH for which more than 50 percent of the phenol molecules are in the deprotonated form (CoHsO (aq). Justify your answer. 1 2 3 4 5 6 7 8 9 10 11 12 13 14 Justification: (d) CeHsOH(ag) reacts with NaOH(ag). Write a net ionic equation representing this reaction (aka: invasion equation). (e) What is the pH of the resulting solution when 30 mL of 0.40 M CSH5OH(aq) is added to 25 mL of 0.60 M NAOH. Show all work…
3. A 0.0560 g quantity of acetic acid is dissolved in enough water to make 50.0 mL of solution. Calculate the concentrations of H;O*, CH;COO and CH;COOH at equilibrium. What is the pH of the solution? (Ka = 1.8x10) CH;COOH(aq) = CH;COO (aq) + H;O* (aq) a) Calculate the initial concentration of CH;COOH. (C:12; H:1; 0:16) b) Calculate the concentration of CH;CoO (aq) and H;O* (aq) at equilibrium. c) Calculate pH of the solution.
Calculate the pH of a 8.3 x 10-M solution of H2SO4 (K, = 1.2 x 10-2). pH =
C9 H13 N is a weak base with a pKb of 4.2. Calculate the pH of a solution containing an C9 H13N concentration of 220 mg/L.
Determine the [H3O⁺] in a 0.265 M HClO solution. The Ka of HClO is 2.9 × 10-8. Determine the pH of a 0.461 M C6H5CO2H M solution if the Ka of C6H5CO2H is 6.5 x 10-5.