Answered: method for the preparation of oxalic…

Science

Chemistry

method for the preparation of oxalic acid. 2. Give three uses of oxalic acid. 3. Give the common name, IUPAC

Chemistry for Today: General, Organic, and Biochemistry

9th Edition

ISBN:9781305960060

Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Publisher:Spencer L. Seager, Michael R. Slabaugh, Maren S. Hansen

Chapter15: Carboxylic Acids And Esters

Section: Chapter Questions

Problem 15.58E

See similar textbooks

Related questions

Q: A scientist measures the standard enthalpy change for the following reaction to be 161.3 k):…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Complete the following reaction scheme. Show stereochemistry where necessary. Show all organic…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: 44. If the reaction A + B = C has an equilibrium constant greater than 1, which of the following…

A: The reaction given is, => A + B ↔ C K > 1

Q: НО SH CH2OH NC

A: Given molecule is : In the given alkene below, what is the configuration of the double bond? Write…

Q: Illustrate with equations the preparation of acetic acid by Grignard synthesis.

Q: Use the following atomic masses (in g/mol): Mg = 24.31; O = 16; Ca = 40.08; C = 12.01; Na = 23; H =…

A: HCl + NaOH→ NaCl + H2O at equivalence point Number of equivalents of HCl = Number of equivalents of…

Q: 16. If toluene is synthesized from benzene and methyl chloride, what reaction has been observed? A.…

Q: 3. Integrated Rate Laws Formulas: In[A] = -kt + In[A]o t1/2 = 0.693/k The rate constant of the…

Q: Why are peak areas used instead of peak height in Reverse Phase HPLC of Caffeine and Benzoic Acid?

A: In case of carrying out HPCL of caffeine and benzoic acid, peak heights are better option for…

Q: A student is using a calorimeter to determine the specific heat of a metallic sample. She measures…

A: Here we are required to find the specific heat capacity of the unknown metal

Q: A 1.2 g sample of mixture of NaOH and Na:CO, containing inert impurities s dissolved and titrated…

A: Given : Weight of sample = 1.2 g Concentration of HCl = 0.5 N Volume of HCl required to reach…

Q: Alkenes can be synthesized from alkyl halides when this compound is used as a reactant: A. Sodium…

A: Elimination reaction of alkyl halide: Alkyl halide gives an elimination reaction by reacting with a…

Q: Question 10 Which scenario describes the most effective method of managing electronic waste to pro-…

A: e-waste management is a major task and challenge for the entire world.

Q: 20.77. The nitration of methanol, CH;OH, by nitrous acid is thought to proceed via the following…

Q: Friedel-Crafts alkylation

Q: Determine if the acid-base neutralization reaction of hydrochloric acid (HCI) with sodium hydroxide…

A: ΔG0 = ΔH0 - TΔS0 ΔG0 = Change in free energy ΔH0 = Change in enthalpy T = Temperature ΔS0 =…

Q: What is the ratio of base to acid required to create a buffer system using nicotine (C10H14N2, K…

A: Given data Kb of nicotine (C10H14N2) =1.00×106 pH of the buffer solution = 9.2

Q: Calculate the pH of 1.0M NaHSO2 solution. (Ka1=1.2x10-2 ; Ka2=6.6x10-8). Show the complete solution

A: Answer: pH = 3.59

Q: 23. Which conditions favor an efficient (fast, high yield) Sn2 reaction between an appropriate alkyl…

Q: Which of the following compounds is the most reactive towards NaOH in water? a. 2,4-dinitrotoluene…

Q: Cu(NH,), complex K, = 2.09 × 103 For the aqueous at 25 °C. Suppose equal volumes of 0.0020M Cu(NO,),…

A: Here the complex formation constant of [Cu(NH3)4]2+ is 2.09×10^13 , hence initially the reaction…

Q: Calculate the solubility (in g/L) of O2 in water at a partial pressure of O2 of 120. torr at 25oC.…

A: Given, The partial pressure of O2 = 120. torr K (O2) = 780. atm×L/ mol , the solubility of…

Q: A. Indicate the appropriate chemical name for each of the following structures. OMe a) Et…

A: the appropriate chemical name for the following structures is:

Q: What are the signs of AS, AH, and AG for the sublimation of dry ice (solid CO2) at 25°C? AS ΔΗ AG

A: According to the answering guidelines, I'm posting the solution for the first question. Kindly post…

Q: Which of the following alkyl halides will exhibit the lowest boiling point? A. Ethliodide B.…

A: Boiling point of a compound is dependent on various factors as discussed in the following step.

Q: 1. 2. CO2H co,H CH,C= CCH=CHCO2H CH3CHCH2CH2CHCH3 4. CH3 CH3CN 3. CO2H 5. CN NC .CO2H 6.

Q: D ОН ČI

Q: At 300°C and at a pressure of 0 – 60 atm, the Joule-Thomson coefficient of N2(g) can be represented…

A: Solution -

Q: 2. Calculate the AS° of the given reaction. Саз (РОд)2 Саз (РОд)2s Са 2+ + РОд 3- PO4 (ag) -207.0 Са…

Q: Write a balanced chemical equation based on the following description: solid silicon dioxide and…

A: Balanced chemical equation is the equation in which equal number of atoms are present on both sides…

Q: What elutes first in reverse phase hplc caffeine or benzoic acid? Explain by relating polarity and…

A: A question based on analytical separation that is to be accomplished.

Q: Find the AH (kJ) for the reaction below, given the following reactions and subsequent AH values:…

A: Find ∆H fir the reaction, N2H4 + 2H2O2 -----> N2 + 4H2O ∆H = ?

Q: What is the expected product of the following reaction ? 1) NAOME 2) CH;Br 3) H;O*heat

Q: Consider the reaction below. What are the structures of compounds J and K? Choose two (2) answers Mg…

A: Here we are required to predict the product of the reaction

Q: In snythesizing diethyl ether from ethanol using concentrated sulfuric acid, increasing the reaction…

A: Detail description is given below

Q: Consider two identical metal spheres, A and B. Sphere A carries a charge of – 48 µC and sphere B…

A: As two sphere touches to each other, negative charge will be transferred from the sphere with a…

Q: Potassium iodate solution was prepared by dissolving 1.022 g of KIO3 (214.00 g/mol) in a 500-mL…

A: Molarity of a solution = Number of moles of solute/ volume of solution in L Number of moles of a…

Q: Is the reaction Si (s) + 2 H2 (g) --> SiH4 (g) spontaneous under standard conditions at 298 K?…

A: Given, Reaction : Si(s) +2H2(g) →SiH4(g) Temperature, T=298 K

Q: A coffee-cup calorimeter contains 70 mL of water with an initial temperature of 24.9°C. An unknown…

Q: B. Calculate the molality of a water solution if the freezing point is: 6. -9.3°C 7. -27.9°C

Q: Mg ethyne ► J + K -Br ether

Q: What is the increasing order of basicity among the following compounds ? NH „NH „NH NH но OH II III…

A: Given, Options are :

Q: Section 1.1 Chemistry in Context 1. What is the purpose of using the Scientific Method? 2. Define…

A: Question 1 - - > The scientific method is the process by which scientists attempt to…

Q: For each of the following indicate the direction of the shift (6A) 1. 2503 (g) + 100 kJ= 2502 (g) +…

A: 2SO3(g) +100KJ <----> 2SO2(g) + O2(g) According to Le-chatelier principle if equilibrium is…

Q: C. Basic Properties Draw the following structures on MolView. Obtain the charge and bond dipoles of…

Q: Strength of intermolecular forces: Dispersion Forces 1.9 Non-polar covalent bond Polar covalent…

Q: Standardization of Hydrochloric Acid Solution Answer the concentrations in 3 significant figure. The…

A: The balanced equation for the reaction of Na2CO3(aq) with HCl(aq) is: Na2CO3(aq) + 2HCl(aq) ---->…

Q: Consider the reaction scheme below. Br2 FeBr3 CI AICI3 NaOH Y warm What are the structures of X, Y,…

A: Given reaction diagram is : Identify the X, Y and Z products = ?

Q: Determine the E°cell for the cell represented by the combination of the following half-reactions?…

A: E°cell = E°catode - E°anode

Q: The molar absorptivities of the indicator weak acid HIn (Ka = 1.42 x 10-5) and its conjugate base…

A: The absorbance of the mixture of two species can be written as: A=εHInbCHIn+εIn-bCIn-

Question

Illustrate with equation one method for the preparation of oxalic acid.

2. Give three uses of oxalic acid.

3. Give the common name, IUPAC name and structure of the first six members of

the dicarboxylic acids.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Step by step

Solved in 3 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

1) To identify which contains more acid vinegar or lemon juice neutralization with sodium hydroxide can be used. Explain how. 2) The long filaments making up the thread of woven synthetic fabrics are likely polyesters. Describe the special characteristic that the alcohol and carboxylic acid must have so that they can react with each other to produce such long filaments.
1. Why is the internal use of methyl salicylate limited to small quantities only? 2. What are the uses and application of methyl salicylate? 3. What is the role of salicylic acid, sulfuric acid and sodium carbonate in the synthesis of methyl salicylate? 4. What are the common methods to extract methyl salicylate from natural sources?
Please explain and draw Lewis structures for a balanced chemical reaction showing the hydrolysis of ethyl acetate with sodium hydroxide.
Use an appropriate reaction to illustrate the acid character of benzoic acid.
Write the products of the reaction of diphenhydramine (a base) with the acid HCl shown below. Are the reactants or products more soluble in water? Briefly explain.
why n-hexanol has higher boiling point than n-hexane. why acetic acid is more acidic then butanoic acid. why sugar is soluble in water in terms of their molecular interactions.
1. Give a general equation for the hydrolysis of the tannins that are esters of gallic acid and glucose. It is not necessary to balance this equation, but indicate the reactants and products by general structure.
I. Complete the table. Classification of Carboxylic Acids and its derivatives No. Common Name Structure IUPAC Name 1. CH3CH2CH2COONA COOH(CH2)SCOOH 3. CH3CH2CH2CH2CH2COOH 4. C6HSCOOCOC6H5 5. CICOCH2CH2CH2CH2OH 6. CH3(CH2)7CONH2 7. CH3(CH2)3CH2COOCH2(CH2).CH3 CH3CH2OCOCH2CH2CH2CH2CH2CH2 8. CH3 9. CH3CH2CH2CH2CH2CH2CH2CH2COCI 10. H2NCOCH2CH2CH2CH3 2.
Write the acid dissociation chemical equation for acetic acid and the chemical equation for the reaction of acetic acid with sodium hydroxide.
What is the role of phenolphthalein in the neutralization reaction? Draw the structure of phenolphthalein under acidic and basic conditions.
Lipoic acid is required by many microorganisms for proper growth. As a disulfide, it functions in the living system by catalyzing certain oxidation reactions and is reduced in the process. Write the structure of the reduction product.
How many mL of a 0.100M NaOH solution would be needed to titrate 0.156g of butanoic acid to a neutral pH endpoint?