A battery relies on the oxidation of magnesium and the reduction of Cu?+ . The initial concentrations of Mg2+ and Cu2+ are 1.2x10-4 mol L-1 and 1.5 mol L-1, respectively, in 1.0-litre half-cells.Part AWhat is the initial voltage of the battery?Express your answer using two decimal places.* (3 ED ?ReV =VSubmitRequest AnswerPart BWhat is the voltage of the battery after delivering 5.0 A for 8.0 h ?Express your answer using two decimal places.V =VSubmitRequest AnswerPart CHow long can the battery deliver 5.0 A before going dead?Express your answer using two significant figures.i (3 E3 ?t =h

Answered: Image /qna-images/answer/02b95da6-9714-4d18-9c13-1bce5a14f463.jpg

- Part A What is the initial voltage of the battery? Express your answer using two decimal places. (3 EB 1? V Submit Request Answer - Part B What is the voltage of the battery after delivering 5.0 A for 8.0 Express your answer using two decimal places. (3 EB 1? V = V Submit Request Answer - Part C How long can the battery deliver 5.0 A before going dead? Express your answer using two significant figures. h

- Part A What is the initial voltage of the battery? Express your answer using two decimal places. (3 EB 1? V Submit Request Answer - Part B What is the voltage of the battery after delivering 5.0 A for 8.0 Express your answer using two decimal places. (3 EB 1? V = V Submit Request Answer - Part C How long can the battery deliver 5.0 A before going dead? Express your answer using two significant figures. h

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter18: Introduction To Electrochemistry

Section: Chapter Questions

Problem 18.3QAP

See similar textbooks

Similar questions

For a certain cell, G=25.0 kJ. Calculate E° if n is (a) 1(b)1(c) 41 Comment on the effect that the number of electrons exchanged has on the voltage of a cell.
Which of the changes below will increase the voltage of the following cell? Co|Co2+(0.010M)H+(0.010M)|H2(0.500atm)|Pt (a) Increase the volume of COCl2 solution from 100 mL to 300 mL. (b) Increase [H+] from 0.010 M to 0.500 M. (c) Increase the pressure of H2 from 0.500 atm to 1 atm. (d) Increase the mass of the Co electrode from 15 g to 25 g. (e) Increase [CO2+] from 0.010 M to 0.500 M.
Use the following half-equations to write three spontaneous reactions. Justify your answers by calculating E° for the cells. 1. MnO4(aq)+8H+(aq)+5eMn2+(aq)+4H2OE=+1.512V 2. O2(g)+4H+(aq)+4e2H2OE=+1.229V 3. Co2+(aq)+2eCo(s)E=0.282V
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For the standard cell potentials given here, determine the ?G for the cell in k].. (a) 0.000V,n=2 (b) +0.434V,n=2 (c) -2.439 V, n = 1
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).