Provide the correct IUPAC/systematic name for the following compound

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: What is the systematic (IUPAC) name of the following compound?

A:

Q: What is the IUPAC name for the compound shown in the image?

A: The given compound is saturated hydrocarbon and has a ring structure with 5 carbon atoms. Since it…

Q: Which of the following is the IUPAC name for the following compound?

A: Select the principle carbon chain  Numbering  Naming (prefix + word root + suffix)

Q: correct IUPAC name

A:

Q: Give the IUPAC name for the following compound:

A:

Q: Fill in the blank: What is the IUPAC name for the following compound?

A:

Q: Name the compound according to IUPAC nomenclature.

A: Given,

Q: The IUPAC name of the compound below

A: Organic compounds are named according to the IUPAC nomenclature which has some general rules. The…

Q: What is the correct IUPAC name for the following compound?

A:

Q: IUPAC name for the following compound?

A: The IUPAC name of the given compound ca be written as

Q: What is the IUPAC name of this compound?

A:

Q: Provide the correct IUPAC name for the compound shown here. عمليه

A:

Q: Provide the IUPAC name of the compound shown below.

A:

Q: Give  the correct IUPAC name and spelling of the following compounds. Note proper notations (like…

A:

Q: The IUPAC name for the following molecule is:

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Give the IUPAC name for the following compound

A:

Q: Provide the correct IUPAC names for the following compounds:

A:

Q: Give the IUPAC name for the following compound.

A: Step : 1           Give the IUPAC name for  the following compound.

Q: Provide the correct IUPAC name for the compound shown here

A:

Q: Provide the IUPAC names for the following molecules

A: The IUPAC names for the given molecules can be provided as,

Q: IUPAC name with E and Z Relerenc Provide the IUPAC name for this compound.

A:

Q: name the following compound IUPAC rules

A: IU PAC momenclatune contains 5 pant 2°prefin +    1°prefin+            wow root +…

Q: Provide the correct IUPAC name for the compound shown here. НО

A: • The longest carbon chain in the given compound contains four carbon atoms. Therefore, the root…

Q: Provide IUPAC name for the following compounds.

A:

Q: What is the IUPAC name of the following compound

A: According to the question, we need to determine the IUPAC name of the organic compound.    In this…

Q: What is the IUPAC name for the compound shown below?

A: First , Choose the longest carbon chain which has highest number of carbon ,then start  numbering to…

Q: What is the IUPAC name for the compound shown below? он Он

A: The given compound contains 3 carbon atoms that are connected linearly and 2 –OH groups are…

Q: Name the following using IUPAC nomenclature. CI

A: IuPAC name should be assigned by following some rules.

Q: Give the IUPAC name for each of the following compounds:

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: What is the IUPAC name of the molecule shown?

A: When doing IUPAC name of a cycloalkane, start numbering the carbons of a cycloalkane with the…

Q: What is the correct IUPAC name of the following compound?

A: An IUPAC name of a molecule is also called a systematic name as it is created obeying some specified…

Q: CI

A: The correct IUPAC name of the structure is given below.

Q: What is the IUPAC name for the following compound? CI.

A: The iupac name is as follows:

Q: Provide the correct IUPAC name for the compound shown here.

A: we have to name the given structure

Q: What is the IUPAC name for the compound?

A: Alcohol is an organic compound having      -OH functional group and while doing IUPAC naming suffix…

Q: The IUPAC name for the two following compound is:

A:

Q: Provide the IUPAC name for the compound shown below.

A: Answer :-  6,6-dimethyl-3-heptyne      or          6,6-dimethylhept-3-yne…

Q: What is the IUPAC name for the following compound?

A: The name of the compound contains  prefix + root word + suffix. Prefix indicates the substituent.…

Q: Provide proper IUPAC name for the following compound:

A:

Q: Provide proper IUPAC name for the following compound::

A: In this question, we have to give the IUPAC name of the given compound.

Q: Provide the IUPAC name of the following compound?

A:

Q: IUPAC name for the following compound.

A: As the given structure is Alkane. So prefix used is ane. In iupac name. First we select longest…

Q: Write a complete IUPAC name for each of the following compounds

A: In this question, the IUPAC name of the provided compounds has to be determined. (i) IUPAC Name:…

Q: give the proper IUPAC name for the following compounds

A: To get the IUPAC name first we will have to give numbering. Then according to the substituents the…

Q: IUPAC name

A:

Q: What is the correct IUPAC name of the following compound? но

A: Carboxylic acids have –COOH as the functional group. This functional group is bonded with the parent…

Q: Name the following compounds using the IUPAC system

A: IUPAC nomenclature :  IUPAC naming rules  Choose the longest chain, numbering starts from high…

Q: CI 心

A:

Q: Write a complete IUPAC name for each of the following compounds.

A: The solution is given below -