Answered: Provide the CORRET name for the…

Provide the CORRET name for the incorrectly named compounds, and explain why the names given are incorrect: 2-ethylpropane 1, 3 – dimethylpentane 2-dimethylbutane 3-methylbutane

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter22: Organic And Biological Molecules

Section: Chapter Questions

Problem 3Q

See similar textbooks

Related questions

Q: IUPAC Name Condensed Structural Formula Zigzag line Structural Formula 7. 2,5-dimethyl-3-hexene 8.…

A: Draw the structural diagram

Q: The following names are incorrect. Write the structural formula that agrees with the apparent name,…

Q: What is the correct IUPAC name for the following organic molecule? a.…

Q: Given each of the IUPAC names provided, draw the corresponding structure.(a)…

A: Since we answer only up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: Which of the following names are correct and which areincorrect? If incorrect, write the correct…

A: a. 2,3-Dibromocyclobutane Incorrect name. Correct name will be 1,2-Dibromocyclobutane b.…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: Hi there, As there are multiple subparts, we are answering first 3 subparts. if you need further…

Q: Given each of the IUPAC names provided, draw the corresponding structure. (a)…

Q: 1. 2. 3.

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

A: In organic chemistry the name of any organic compound is given by the IUPAC nomenclature. There are…

Q: Which of the following is an incorrect IUPAC name for a cycloalkane? 3,3-dimethyl-cyclopentane…

Q: Isomers are molecules that share the same formula and have a different shape to the molecule the…

A: ->Isomers are compounds having the same molecular formula but different properties due to…

Q: The following names are incorrect: State why each name is wrong and give the correct name…

A: Rules to write the structure of the compound from the given IUPAC name: The name of the longest…

Q: Are the following names correct or incorrect? If they areincorrect, give the correct name.a.…

A: Are the following names correct or incorrect? If they are incorrect, give the correct name. a.…

Q: Draw a structure corresponding to the following IUPAC name:…

A: Structure of a compound, IUPAC named 4-methyl-1-(2, 2-dimethylpropyl)cyclohexane

Q: . What is the IUPAC name of the following compound? CI a) 3-Ethyl-2-methyl-4-chloropentane b)…

Q: 1. What is the correct IUPAC name for 2-propylpentane (For Alkene and Alkyne Naming, follow this…

A: Since we only answer up to 3 sub-parts, we’ll answer the first 3. Please resubmit the question and…

Q: What is the IUPAC name of this molecule? a. 1-chloropentane b. 2-chloro-1-ethylethane c.…

A: IUPAC is nomenclature in organic chemistry. It is a method of naming organic chemical compounds. It…

Q: What is the IUPAC name for the compound shown? CI H3C, CH3 H3C CH3 CI The IUPAC name is: CI O…

A: We have to predict the correct IUPAC nomenclature of given structure.

Q: Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the…

A: In order to write iupac name we have to follow some rule 1) first select longest carbon chain 2)…

Q: Draw the Skeletal Formula of the following compounds. The parent chain should be drawn in STRAIGHT…

A: Skeletal formula include the structure of the compound from the given IUPAC name.

Q: Explain why each of the following is an incorrect IUPAC name. Write the correct IUPAC name for the…

A: Hii there, As there are multiple sub parts posted. we are answering first-three sub parts . If you…

Q: Given each of the IUPAC names provided, draw the corresponding structure. (a) 1-ethoxypropane; (b)…

A: (a)

Q: A student was given the following list of structural formulas of several compounds and was asked to…

Q: CH3 H3C CH3 CH3 H3C

A: Given : Structure of the compound. To find : IUPAC name of the following compound. Solution : As we…

Q: The correct IUPAC name for the following compound is CH2 H2 H3C. CH3 H3C CH3 a.…

A: Answer

Q: Draw the open structures of the molecules named below according to the IUPAC naming system.…

A: Introduction : We need to tell the structures of following molecules . Since, isopropoxy can be…

Q: Each of the following IUPAC names is incorrect. Explain why it is incorrect and give the correct…

Q: The following names are incorrect: State why each name is wrong and give the correct name…

A: Organic compounds are named in accordance with IUPAC nomenclature. According to the nomenclature,…

Q: Provide the IUPAC name for the following compound: O3-methyl-2-propylpentane…

A: To provide the IUPAC name for the following compound. Rules for naming a compound in IUPAC are:-…

Q: Give the correct IUPAC name of the following compound: ... A 2,5-Dimethyl-3-propylheptane B…

A: Write the IUPAC name of the given structure ----

Q: What is the IUPAC name of the following compound? CH;CH2C(CH3)½CH2CH(C>H5)2…

A: Rules for naming the organic compound is as follows; Choose the longest continuous carbon chain.…

Q: Select the correct IUPAC name for (see image) a) 3-ethyl-2,4,5-trimethyloctane b)…

Q: Organic Compound IUPAC name If incorrect... Correct (v) or provide reason(s) for your answer and a…

Q: Given each of the IUPAC names provided, draw the corresponding structure. (a)…

A: (a)

Q: Give the IUPAC name for the following compound: Multiple Choice (1R,3R)-1-ethyl-3-methylcyclohexane…

A: Answer 2 Introduction: IUPAC nomenclature: IUPAC stands for International Union of Pure and Applied…

Q: What is the correct IUPAC name for the compound below? A) 2,2,4-trimethylpentane B)…

Q: What is the IUPAC name of this compound? CH 3 CH 2 CH 2 CH 2 CH 2 CH 2 CH 3 heptane butane octane…

A: -> For IUPAC naming following steps are required First of all identify the longest carbon chain…

Q: 4,6-dimethylcyclohexane is incorrect according to IUPAC. Which of the following is the correct…

Q: What is the IUPAC name for the following compound? 3-Ethyl-2,5-dimethyloctane…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the correct IUPAC name for the following compound CH3-CH(CH3)-CH(C2H5)-CH2-CH(CH3)-CH3?…

A: Basic Rule to write IUPAC Name (1) Select the longest chain (2) Numbering start from those side…

Q: Draw each of the following molecules based on the name given, then decide which are valid systematic…

A: The given molecules are 1,5-dimethyl-3-heptene, 3-propylheptane, 3-methyl-2-pentyne,…

Q: CH3 CH CH2 CH CH3 H3C H2C-CH3

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Draw the open structures of the molecules named below according to the IUPAC naming system.…

A: 1) The IUPAC name given is 2-hydroxy-3-pentenal The IUPAC name given is incorrect as the aldehyde…

Q: On a clean sheet of paper, draw acceptable chemical structures for the following compounds. Please…

A: a. 2,3,4-trimethyloctane

Q: For each, draw a structural diagram (ine, conderised or complele) IUPAC Name Condensed Formula…

Q: Write the condensed structural formula for each of the following molecules 3-ethylhexane…

A: Condensed Molecular Formula In condensed molecular formula most of the bonds are omitted and this…

Q: What is the correct IUPAC name for the compound above? a. 2,3,4-trimethylhexane b.…

A: Organic compounds are named as per the guidelines proposed by the International Union of Pure and…

Q: Determine which part/s of the following IUPAC name made them incorrect: locant, parent length,…

A: IUPAC stands International union of pure and applied chemistry. It is for the systematic…

Q: Select the correct IUPAC name for: 5-methyl-5-ethyloctane 3-methyl-3-propylheptane…

A: We would write IUPAC name of given compound using IUPAC rules. Which are given as : 1.) First we…

Q: The names given for the following unsaturated hydrocarbons are incorrect based on IUPAC…

A: 1. 1,6-diethylhept-5-en-1,3-diyne: According to this name the structure of the compound is as…

Question

Provide the CORRET name for the incorrectly named compounds, and explain why the names given are incorrect:
1. 2-ethylpropane
2. 1, 3 – dimethylpentane
3. 2-dimethylbutane
4. 3-methylbutane

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

The name for the compound with the following structure is CH3CHCH2CH=CH2 ČH3 O 2-methyl-4-pentene O4,4-dimethyl1-butene 2-methyl-2-pentene O 4-methyl-1-pentene O 2-methyl-1-pentene The name for the compound with the following structure is CH 3 H3 C- CH-c= CH O 3-methyl-2-butyne O 3-methyl-1-butene O 2-methyl-1-propyne 2-methyl-3-butyne O3-methyl-1-butyne
Write structures for the following compounds. 3-ethyl-4-methylhexane 4-tert-butyl-2-methylheptane ) 3-ethyl-5-isobutyl-3-methylnonane D 5-isopropyl-3,3,4-trimethyloctane
The following names are incorrect. write the correct IUPAC name of the compound that agrees with the apparent name and then. 2-Ethylbutane 5-ethyl-1,1-methyl cyclopentane 3-Ethyl-3,5,5-trimethylhexane 1,2-dimethyl-4-ethyl cyclohexane
Name the following organic compounds: compound CH3CH₂CH₂ 1 CH3CH₂CH₂-C- CH₂ CH₂ CH3 1 CH₂ - CH₂ name 4-ethyl-4-propylheptane
A student was given the following list of structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed and explain why it is incorrect. 2,2-dimethyl-4-ethylheptane 5-(2,2-dimethylethyl)nonane 3,3-dichlorooctane 5-ethyl-2-methylhexane 3-isopropyloctane 2-methyl-2-isopropylheptane
Which is a structural isomer of 3-ethyl-3-methylhexane? - 2,8-dimethylnonane - 2,7-dimethyloctane - 2,2,3,3-tetramethylpentane - 3,3-diethyloctane
What is the correct molecular structure for 1-cyclopropyl-3-ethyl-4-methyl hexane?
The correct IUPAC name for the following compound is: CH3CH2CCH2CH2CH2C1 CH2 1-Chloro-4-methylenehexane 1-Chloro-4-ethyl-4-pentene 5-Chloro-2-ethyl-1-hexene 5-Chloro-2-ethyl-1-pentene 2-(3-Chlorophyl)-1-butene
Draw the structural formula of the following compounds. 1) 1-ethyl-3-methylbenzene (What is the common IUPAC name?) 2) Propylbenzene 3) 2-phenylpentane
None of the following names follow IUPAC rules (formulas are provided to reduce ambiguity): 2-oxo-4-pentanol (C5H1002) 5-propyl-4-chloro-2-hexanone (C,H17CIO) N-propylethenamine (C5H11N) Choose one of these names, explain what is wrong with it, and write the correct IUPAC name of the compound.
Name the following: H H H-C-C-0-C-C-H | H | H O acetone butyraldehyde diethylketone O diethyl ether O H H T none of these | | H H
WRITE THE STRUCTURAL FORMULA OF THE FOLLOWING: (NOT SKELETAL FORMULA) 5- Ethyldecane 2- Ethyl-5-Methylnonane Undecane