What would be the effect on fatty acid synthesis of a mutation in ATPcitrate lyase that reduces the enzyme’s activity? Explain.
Q: We have stated that fatty acids cannot yield a net gain in carbohydrates in organisms that lack a…
A: Fatty acids are the simplest form of lipids and serve as constituents in a large number of complex…
Q: Why Alpha-Ketoglutarate dehydrogenase (a-KGDH) called deficiency? What are the probable causes?…
A: Alpha-ketoglutarate dehydrogenase (alpha-KGDH) is a tightly controlled enzyme that regulates…
Q: Which step in lipid metabolism would you expect to be affected by 3,4-dihydroxybutyl-1-phosphonic…
A: Lipid metabolism is the synthesis and degradration of lipids in cells, involving the breakdown or…
Q: under what conditions would it have Beta galactosidase activity? JAlith
A: Beta galactosidase work with lactose
Q: What kind of inhibitor is threo-sphingosine? Explain this type of inhibition.
A: Introduction: Enzymes are the catalyst of life. Enzyme inhibitor is defined as a substance which…
Q: Which one of the five steps of the pyruvate dehydrogenase complex reaction is most likely to be…
A: Pyruvate dehydrogenase complex is a group of non-covalently associated enzymes. It catalyzes…
Q: To explain: How would an uncoupler Dinitrophenol of oxidative phosphorylation promote weight loss.
A: The organic chemical compound 2,4-dinitrophenol (DNP) It is a biochemically active chemical that…
Q: Describe the β-oxidation of the fatty acid palmitate
A: Beta oxidation in biochemistry and metabolism is a catabolic process through which fatty acid…
Q: true or false during fatty acid biosynthesis, the product detaches from the fatty acid synthase…
A: Fatty acid synthesis is a metabolic reaction in which fatty acids are formed from acetyl-CoA and…
Q: Why might the compound shown below acts as a transition state analog of phosphoenolpyruvate…
A: Transition state analogue are the molecules which is present transiently during biochemical…
Q: Explain why adipocytes need glucose as well as fatty acids in order to synthesize triacylglycerols.
A: Triacylglycerol is the main component of body fat in humans and other animals (as well as vegetable…
Q: From what fatty acid are most of the eicosanoids derived?List several medical conditions in which…
A: Eicosanoids are signaling molecules that are produced via enzymatic oxidation of polyunsaturated…
Q: Dicyclohexylcarbodiimide (DCCD) is a reagent that reacts with Asp or Glu residues. Explain why the…
A: The process of breakdown of glucose to generate the energy molecule adenosine triphosphate (ATP) is…
Q: Considering the complete oxidation of an 18-C fatty acid. Give the answer for the following…
A: Beta oxidation is a catabolic pathway that converts fatty acid molecules to acetyl CoA. The site of…
Q: Under anaerobic circumstances, why is pyruvate converted to lactate?
A: Anaerobic Glycolysis is the process of glucose oxidation that occurs when oxygen levels are low,…
Q: Discuss why a saturated fatty acid like lauric acid has a good anti-oxidant property.
A: "Since you have asked multiple questions, we will solve the first question for you. If you want a…
Q: What impact would an increase in intramitochondrial oxaloacetate have on fatty acid synthesis?…
A: Fatty acids are carboxylic acids with long hydrocarbon chains. Fatty acids undergo β oxidation when…
Q: Cancer cells have a high amount of hexokinase. Explain why
A: Hexokinase are the enzyme which phosphorylates hexose to hexose phosphate. It does so by…
Q: Are any of the intermediates in the β-oxidation pathway chiral? Explain.
A: Chiral: it is defined as a molecule with lack of internal plane of symmetry and has four different…
Q: In fatty acid synthesis, malonyl-CoA, rather thanacetyl-CoA, is used as a “condensing group.”…
A: Fatty acid synthesis occurs in cytosol. Acetyl CoA is the source of carbon and NADPH provide…
Q: One metabolic scenario that leads to insulin resistance is the elevation of the…
A: Insulin resistance is defined as the inactivity of insulin in its target cells. The examples of…
Q: How many molecules of ATP are obtained from the β-oxidation of one molecule of a 16-carbon saturated…
A: Bio molecules also known as biological molecules. These are the molecules which are produced by…
Q: The thiolate anion of CoA acts as a/an nucleophile attacking the carbonyl carbon of the enzyme bound…
A: Fatty acid are activated to acyl CoA by thiokinase or acyl CoA synthetase. This step occurs in…
Q: . Glucagon secretion causes inhibition of intracellular acetyl-CoA car- boxylase activity by several…
A: Glucagon - It is a hormone, has the ability to regulate the activity of acetyl-CoA carboxylase. It…
Q: Mechanistically, how does NADPH facilitate the removal of an oxygen atom from intermediates in fatty…
A: Fatty acid synthesis is the production of fatty acids from acetyl-CoA and NADPH through the action…
Q: What is deltaG" for this reaction ATP + glucose -> ADP + giucose-6-phosphate deltaG"= ?
A: Glycolysis: a cytoplasmic pathway in which glucose breaks down into two three-carbon compounds and…
Q: List three differences between fatty acid synthesis and β-oxidation.
A: Fatty acid synthesis : It is the creation of fatty acids from acetyl-CoA and NADPH through the…
Q: Glucagon secretion causes inhibition of intracellular acetyl-CoA carboxylase activity by several…
A: Glucagon, a hormone, has the ability to regulate the activity of acetyl-CoA carboxylase. It is able…
Q: Define beta-oxidation of fatty acids? Describe in detail three different steps of beta-oxidation of…
A: Fats are polymers of fatty acids and glycerol. These are major energy reserves. Fats can be of two…
Q: Why is citrate an appropriate inhibitor of phosphofructokinase?
A: Citrate allosterically inhibits phosphofructokinase by enhancing the inhibitory effect of ATP
Q: Which of the following glycosidic linkages is hydrolyzed by the a-amylase?
A: α amylase enzyme belongs to the enzyme group of amylase. Amylases hydrolyses the α-1,4-glycosidic…
Q: This is a conjectural question: If the reactive part of coenzyme A is the thioester, why is the…
A: Coenzyme A Is an important coenzyme that plays an important role in many metabolic pathways.the…
Q: A glycolytic intermediate may be used to make the glycerol 3-phosphate necessary for the production…
A: The Glucose is a main source of energy in practically all living things. Glycolysis breaks down…
Q: A congenital defect in the liver enzyme fructose 1,6-bisphosphatase resultsin abnormally high levels…
A: Bisphosphatase is an enzyme that converts fructose-1,6 bisphosphate to fructose 6-phosphate in…
Q: Explain why people with a hereditary deficiency of carnitine acyltransferase II have muscle…
A: Carnitine acyltransferase II is a mitochondrial membrane protein which is transported mitochondrial…
Q: During fatty acid biosynthesis, is it correct that the product detaches from fatty acid synthase…
A:
Q: In the B-oxidation of a saturated, even chain fatty acid, four basic steps are involved. Describe…
A: In mitochondria, acetyl CoA is important component for Krebs cycle . There are various sources of…
Q: Palmitic acid is a straight-chain saturated 16-carbon fatty acid. How many moles of malonyl-CoA are…
A: Palmitic acid is a straight-chain saturated fatty acid made up of 16 carbons. It is synthesized from…
Q: Explain why, glucose-6-phosphate will prefer to go via the pentose phosphate route. What additional…
A: Metabolism includes biosynthesis/ reduction (an anabolic process) and oxidation (catabolic…
Q: Dicyclohexylcarbodiimide (DCCD) is a reagent that reacts with Asp or Glu residues. Explain why the…
A: ATPase is the enzyme complex, which is known to synthesize ATP by transferring protons and…
Q: We have encountered reactions similar to the oxidation, hydration, and oxidation reactions of fatty…
A: Beta oxidation is a metabolic process in which fatty acid molecules are broken down to create energy…
Q: When the identical subunits of chicken liver fatty acid synthase are dissociated in vitro, all of…
A: The fatty acid synthase is a multi-enzyme protein. It catalyzes the synthesis of fatty acids. In…
Q: Describe the roles of dihydroxyacetone phosphate and fatty acids in the synthesis of triacylglycerol
A: Triacylglycerol are the tri-esters of fatty acids and glycerol. It is made up of one glycerol and…
What would be the effect on fatty acid synthesis of a mutation in ATPcitrate lyase that reduces the enzyme’s activity? Explain.
Step by step
Solved in 3 steps
- What is alpha keto glutarate dehydrogenase complex?. explain very briefly.When the identical subunits of chicken liver fatty acid synthase are dissociated in vitro, all of the activities can be detected in the separated subunits except for the β-ketoacyl synthase reaction and the overall synthesis of palmitate. Explain these observations.In relation to Carbamoyl Phosphate Synthetase enzyme, answer the following: A- What are the two isoforms of this enzyme, explain why there are two isoforms? B- What are the clinical manifestations associated with the deficiency of these two enzymes? C- Write down the biochemical reaction and the name of the metabolic pathway that these two isoforms are involved in, and how many ATP is utilized by these two isoforms?
- Hexokinase catalyzes the first step of glycolysis, in which glucose is phosphorylated to form glucose‑6‑phosphate. Give two reasons why a Mg2+ cation is required to facilitate this reaction.Why might the compound shown below acts as a transition state analog of phosphoenolpyruvate carboxykinase. Explain. A drawing of a normal transition state for this enzyme is needed.Von Gierke’s disease is also known as glycogen storage disease type I. Patients with von Gierke’s disease lackglucose 6-phosphatase activity. Two prominent symptoms of this disorder are fasting hypoglycemia and lactic acidosis (elevated lactate levels in the blood), especially during strenuous exercise. Explain why these symptoms occur. What chemical reaction does this enzyme catalyze? Which pathways involve this enzyme? Lacking thisthe enzyme will cause impairment of which pathways?• Pls consider what pathways are affected by Von Gierke’s disease. Include in your explanation involving Cori’s cycle. can you please do not write by your hand? I mean computer if you can. thank you
- Von Gierke’s disease is also known as glycogen storage disease type I. Patients with von Gierke’s disease lackglucose 6-phosphatase activity. Two prominent symptoms of this disorder are fasting hypoglycemia and lactic acidosis (elevated lactate levels in the blood), especially during strenuous exercise. Explain why these symptoms occur. What chemical reaction does this enzyme catalyze? Which pathways involve this enzyme? Lacking thisenzyme will cause impairment of which pathways?• Pls consider what pathways are affected by Von Gierke’s disease. Include in your explanation involving the Cori’s cycle.Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATPExplain why people with a hereditary deficiency of carnitine acyltransferase II have muscle weakness. Why are the symptoms more severe during fasting?
- The large amount of energy used during aerobic exercise (e.g., running) requires large amounts of oxaloacetate. Explain why acetyl-CoA cannot be used to produce oxaloacetate in this circumstance. What is the likely source of oxaloacetate molecules during aerobic activity?Consider the complete oxidation of one mole of simple TAG containing behenic acid residues (22:0). I. For one mole of the fatty acid residue, determine the following: c. What is the number of ATP yield obtained from FADH2 coming from the complete β-oxidation of the fatty acid residueIn the B-oxidation of a saturated, even chain fatty acid, four basic steps are involved. Describe these reactions using the degradation of palmitic acid as an example.