Which of the following is the MAJOR product of the following reaction? ... EIONA, E:OH Br heat ...

Q: Describe how will you prepare an alcohol from an alkene.

A:

Q: СЕЗ CF3 NaBH4 CH3OH What is the product? -OH is endo or exo? Why?

A: Exo/Endo attack: The attack of nucleophile through the axial or equatorial position, depends upon…

Q: Which of the follwoing compounds is an arene?

A:

Q: NO2 (i) | from pyridine

A: Pyridine can be converted to product by the nitration.

Q: OH LIAH4 SOCz

A: LiAlH4 is known as lithium aluminum hydride,  it is a reducing agent. Which reduces carboxylic group…

Q: Name the following compound: соон ÇOOH СН-ОН CH, - соон

A: The following compound -

Q: Indicate the major organic products from the reaction shown. NH2CH3 HO,

A: In this reaction, the reagent NH2CH3 is electron rich, as it have lone pair of electrons on N-atom .…

Q: 2. Write the structural formula for the major organic product of the following reaction: OH…

A: Carboxylic acid reacts with an alcohol in the presence of an acid-catalyst to form an ester. The…

Q: What is the name of the structure below? CI

A: The given compound consist of a benzene ring which is bonded with four substituents.

Q: 1 equiv Br, OCH3

A:

Q: I. Write the IUPAC name given the structure. .CO2H `N' HO,

A:

Q: 3. Describe oxidation reactions, oxidizing agents, and substitution reactions.

A: Oxidation may be defined as loss of electrons from a substance, the other definition of oxidation…

Q: Give the TUP AC name of the compound

A:

Q: What is the molecular formula for the reaction Na3PO4 .12H20+ BaCl2 . 2H20?

A: Molecular reaction for Na3PO4 .12H20+ BaCl2 . 2H20 ........ need to be write.         Na3PO4…

Q: ethyl vinylether CH3MgBr H3O+, heat TSOH Et,0 НО O=

A:

Q: What type of reaction is shown in the Figure? CI A. Substitution reaction B. Elimination reaction C.…

A: Please find your solution below : The given reaction is an addition reaction.  Therefore, option D…

Q: KMNO4

A:

Q: Consider the following sequence of reactions and identify the structures of compounds A, B, and C.…

A: The reaction schema taking place is given as,

Q: Cl, / CCI, (solvent) H,SO, / ethanol

A: It is electrophile addition reaction

Q: phirylo butame e mothg butonoic acid ,, 3 dichlero pentanoic aud 3 butaneu 2-0xo hex anoic acid

A:

Q: 2. Write the structural formula for the major organic product of the following reaction: HO…

A:

Q: What is/are the major product(s) of this dehydration reaction? OH H2SO4 heat А. В. C. D. O A

A: The products of the given dehydration are/is as follows:

Q: Draw the constitutional isomer formed in attached reaction.

A: To find: The product of the attached reaction

Q: a. Li/CUCL, b. 2 chloro 2 methy propane ČI

A: In this reaction C-C bond formation takes place . This is corey house synthesis reaction.

Q: molecular formula of this compund?

A: Molecular formula of this compund?

Q: Br CH3OH 56°C CH;Li b) -ОН a)

A:

Q: so H,SO, C)

A: The given reaction is an electrophilic aromatic substitution. In an electrophilic aromatic…

Q: Give the major organic product H20 CH; CH;CH,C=CH HgSO, H;SO.

A: 2-pentanone is the major product. ( CH3CH2CH2-CO||-CH3 )

Q: ixture of two alkenes, C 10H 16. The ma d. Which of the following reactions are ce

A:

Q: 9. The compound below is CH, (A) carboxylic acid (B) ketone (C) aldehyde (D) ester

A: An ester is a chemical compound derived from a carboxylic acid in which at least one –OH (hydroxyl)…

Q: HI 2

A: Determine the Product of given Reactant---

Q: According to the product structure of the reaction below, what is the reactant’s structure?

A: This reaction actually known as epoxidation.  When alkene is treated with per acids like m-CPBA ,…

Q: Give the organic product: ? + HBr

A:

Q: Fill-in the missing the reactant, reagent, or major product. 1. Hg(OAc), , H2O 2. NaBH, Biology…

A: The 1st reaction is an example of hydration of alkenes by the reaction called…

Q: Draw the correct organic product for the reaction shown. 1. LIAIH4, Et,0 HO, 2. Hао

A: Interpretation: Acid in the presence of LiAlH4 will show reduction reaction.

Q: 23. What reactant and catalyst is(are) needed to change ethene into ethane? a. H2, Pt b. H2O, H2SO4…

A: Since the conversion is from ethene to ethane  hence the double bond present in ethene i.e CH2=CH2…

Q: Chapter 5: Aromatic Hydrocarbons/Compounds 1. On the structure shown below, indicate the Ortho, Meta…

A:

Q: Ri-Beginning with iodo methane ahd youl Lo yot heed materials betweek how to prepare a) Ethake )…

A: Given reactions, a) Iodomethane to ethane conversion b) Iodomethane to butane conversion c)…

Q: En the given Conversions: propanol-2 → determine compound X, in one of the following write the…

A: The conversion from alchohol to haloalkane involve a reaction in which alchohol is dehydrated to…

Q: What is the range of oxidation states for carbon? Name acompound in which carbon has its highest…

A: Carbon belongs to group 14 of the periodic table and has the electronic configuration 1s2 2s2 2p2.…

Q: 1. BH 3 -1 2. H20,, OH

A:

Q: Oraw the skeletal structure of the reaction product below. 2Brg

A:

Q: Which of the molecules below is NOT organic? O H-N-H H. H-C-OH H-C-O-C-H H. H-C-H H. HICIH HH

A: Organic chemistry :-  Organic chemistry is the branch of science which involve the study of the…

Q: Br, and H,0

A:

Q: Et d ene 3

A: The given organic compound is  CH3-CH2-CH(OH)-CH2-CH2-CH=CH2

Q: This question pertains to organic chemistry 1. How do I know how stable an alkene is?

A: Alkenes:Alkenes are a class of hydrocarbons. The carbon-carbon double bond is called as alkenes and…

Q: 2. What are the resonance structures for the following carbocation? What are the partial charges for…

A: Given carbocation is :  Resonance structures of the given carbocation and resonance hybrid…

Q: 4.1 9 (a) Define geometric isomerism (b) How does geometric isomerism occur in alkenes?

A: (a) - - > Cis-trans isomerism, also known as geometric isomerism is a term used in chemistry to…

Q: explain Z&E alkene

A: There are two types of alkene based on the priority order of the group on either side of the double…

Q: What is the type of each of the following reactions? Write the product of each * reaction

A:

Reactions of Ethers

Ethers (R-O-R’) are compounds formed by replacing hydrogen atoms of an alcohol (R-OH compound) or a phenol (C6H5OH) by an aryl/ acyl group (functional group after removing single hydrogen from an aromatic ring). In this section, reaction, preparation and behavior of ethers are discussed in the context of organic chemistry.

Epoxides

Epoxides are a special class of cyclic ethers which are an important functional group in organic chemistry and generate reactive centers due to their unusual high reactivity. Due to their high reactivity, epoxides are considered to be toxic and mutagenic.

Williamson Ether Synthesis

An organic reaction in which an organohalide and a deprotonated alcohol forms ether is known as Williamson ether synthesis. Alexander Williamson developed the Williamson ether synthesis in 1850. The formation of ether in this synthesis is an SN2 reaction.