Will an amino acid be glucogenic or ketogenic if it is catabolized to the following molecules?(a) Phosphoenolpyruvate(b) -Ketoglutarate (c) Succinyl-CoA(d) Acetyl-CoA(e) Oxaloacetate(f) Acetoacetate
Q: We have stated that fatty acids cannot yield a net gain in carbohydrates in organisms that lack a…
A: Fatty acids are the simplest form of lipids and serve as constituents in a large number of complex…
Q: Which of the following reactions correspond to the decarboxylation step during ketone body…
A: Ketogenesis occurs continually in a healthy person, however it occurs at a faster rate under…
Q: Leucine and Ilysine are ketogenic amino acids. What does that mean for their metabolism? OA) These…
A: Ketogenic amino acids are the amino acid that can be directly degraded into ketone bodies and…
Q: Which isoenzyme of Lactate dehydrogenase is present in blood?.
A: Isoenzymes are physically different from of enzyme that catalyses same biochemical reactions.
Q: Why is pyruvate carboxylase constitutive and active in both glycolysis and gluconeogenesis?
A: The pyruvate carboxylase got multiple sub units of enzymes. Here acetyl CoA helps as an regulatory…
Q: What else can acetyl coA be formed from?
A: Acetyl-coA: The oxidative decarboxylation of pyruvate from glycolysis which occurs in…
Q: Which produces more succinyl-coA concentration: Degrading a 16:0 lipid or degrading a 17:0 lipid? Or…
A: Odd chain fatty acids are the fatty acids with odd number of carbon atoms. Whereas even chain fatty…
Q: is lycopene an intermediate in the biosynthesis of cholesterol?
A: Lycopene, a plant nutrient have antioxidant properties is an intermediate in biosynthesis of many…
Q: Only carbon skeleton of amino acids are used in glucogeneogenesis but not fatty acids. How can fatty…
A: The ketone bodies are water-soluble and can be easily transported from the liver to various tissues.…
Q: Which of the following is a key molecule that functions as oxidation end product in the catabolism,…
A: Fatty acids undergo a catabolic process known as a beta-oxidation pathway in order t generate energy…
Q: What are the precursors needed to synthesize myristic acid? O 7 malonyl-CoA H O 3 acetyl-CoA, 4…
A: Introduction: Myristic acid is also known as tetradecanoic acid, which is a saturated fatty acid…
Q: Which of the following biochemical conversions can be carried out by the least number of proteins?…
A: Cellular respiration is a metabolic process that take place in the cells of organisms, which…
Q: What are the unique enzymes needed to b-oxidize a polyunsaturated fatty acid?
A: Polyunsaturated fatty acid : It are fatty acids that contain more than one double bond in their…
Q: If the w-carbon atom of a fatty acyl CoA molecule with a C18 chain is labeled with C14, how many…
A: Fatty acids consist of an carboxylic acid group at one end of the molecule, thus making it an acid.…
Q: Is it possible to convert fatty acids to other lipids without acyl-CoA intermediates?
A: Fatty acids are building blocks of lipids. They combine with alcohol to form simple fats, such as…
Q: Lipases break down triacylglycerols by catalyzing hydrolysis. What are the products of this…
A: Lipases hydrolyze triglycerides into their component fatty acid and glycerol molecules.
Q: What properties of glucokinase allow it to phosphorylate glucose in the liver when the blood glucose…
A: Glucokinase is an enzyme that facilitates phosphorylation of glucose to glucose-6-phosphate.…
Q: Beta-Oxidation of a 15:14⁹ fatty acid will result in the production of which of the following? 7…
A: The given fatty acid is composed of 15 carbon and it has a single double bond present in it. It…
Q: What are the main differences between beta oxidation of saturated fatty acid and beta oxidation of…
A: Beta oxidation is a catabolic process in which fatty acids are broken down into acetyl co A and…
Q: How many moles of Acetyl CoA are produced from the beta oxidation of Lauric Acid?
A: Biomolecules are organic molecules present in living organisms. The major biomolecules are proteins,…
Q: branched chain amino acids form Succinyl CoA when catabolize
A: Catabolism of valine produce succinyl co-A.
Q: What is the normal fate of citrate formed by the condensation of acetyl CoA with oxaloacetate?
A: Introduction: The oxaloacetate combines with acetyl CoA to form citrate which is the starting point…
Q: Which of the 20 “standard” amino acids are (a) purely glucogenic, (b) purely ketogenic, and (c) both…
A: Protein molecules consist of hundreds of amino acids linked by peptide bonds. They are built from…
Q: What is the origin of the triacylglycerols transported by very low-density lipoproteins?
A: Very low-density lipoproteins (VLDL) carry about 47% triglycerides and 53% cholesterol in the body.…
Q: Although animals cannot synthesize glucose from acetyl-CoA, if a rat is fed 14C-labeled acetate,…
A: Muscles are defined as the soft tissue that is responsible for bringing movement in different body…
Q: What are the unique enzymes needed to -oxidize amonounsaturated fatty acid?
A: Fatty acids are a source of energy in living organisms. Fatty acids can be saturated or mono- or…
Q: What are the substrates for gluconeogenesis? What role do fatty acids play ingluconeogenesis?
A: Gluconeogenesis is the metabolic pathway that results in the generation of glucose from certain…
Q: Starting with acetyl-S-enzyme-1 and malonyl-CoA, how many molecules of acetyl-CoA synthesize an…
A: * Acetyl CoA is a molecule that involves in many biochemical reactions like protein and…
Q: In general, how does oxidative deamination differ from transamination?
A: When there is excess of protein or amino acids they can be degraded to ammonia or other compounds.…
Q: Why are animal fats sometimes called “the king of fuels”? What is the significance of acetyl-CoA to…
A: The building blocks of the living system is the biomolecules. The biomolecules serve as the…
Q: What are the unique enzymes needed to b-oxidize a monounsaturated fatty acid?
A: Monounsaturated fatty acid : It are healthy type of fat. replacing less healthy fats, such as…
Q: The following link carbohydrate metabolism with lipid biosynthesis: (a) How many molecules of…
A: Glycolysis is the catabolic process that involves the oxidation of glucose which leads to the…
Q: Why does it make good metabolic sense for phosphoenolpyruvate carboxykinase, rather than pyruvate…
A: Guconeogenesis is the process whereby glucose is formed from non-carbohydrate metabolic substrate…
Q: If both cysteine residues on the B chain of insulin were changes to alanine residues, how…
A: Insulin is made up of two chains A chain and B chain. Both the chains are linked together by two…
Q: Alcohol dehydrogenase, found in liver cells, converts ethanol into cetaldehyde. What type of…
A: Proteins are formed of amino acid monomers, linked by peptide bonds. They serve various important…
Q: Palmitic acid is a straight-chain saturated 16-carbon fatty acid. How many moles of malonyl-CoA are…
A: Palmitic acid is a straight-chain saturated fatty acid made up of 16 carbons. It is synthesized from…
Q: In gluconeogenesis, only the carbon skeletons of amino acids, not fatty acids, are utilised. So how…
A: The metabolic process or cycle in which lipids are digested or broken down to release or create…
Q: For saturated fatty acids, these reactions can continue as you have drawn until all the carbons of…
A: in beta oxidation [BO], an activated acyl Co-A [~activated fatty acid with the expense of ATP] is…
Q: Three metabolites that can result from the breakdown of the carbon skeleton of amino acids are…
A: Amino acid catabolism is a part of the whole body catabolism. Nitrogen enters the body in a variety…
Q: Why is oxidative decarboxylation important?
A: The citric acid cycle is the last frequent mechanism for fuel molecules to be oxidized. It also acts…
Q: Under conditions where ketone bodies are being produced in the liver, how many ATPS can be produced…
A: Ketone body is the product of fatty acid break down. It is produced when the body has a low intake…
Q: How is acetyl coA carboxylase being regulated?
A: Fatty acids are the components of lipids. Fatty acids act as energy source when there is no dietary…
Q: Which of the following biochemical conversions can be carried out by the least number of proteins?…
A: Fatty acid synthesis is a major anabolic pathway in organisms. They are important component of…
Q: What is gluconeogenesis? Why is it important?
A: Gluconeogenesis is the process of synthesis of glucose from non-carbohydrate sources like proteins…
Q: Identify the products generated by the action of pancreatic lipase on the lipid shown.
A: Pancreatic lipase is considered as an enzyme, which is known to digest lipids and these are released…
Will an amino acid be glucogenic or ketogenic if it is catabolized to the following molecules?
(a) Phosphoenolpyruvate
(b) -Ketoglutarate
(c) Succinyl-CoA
(d) Acetyl-CoA
(e) Oxaloacetate
(f) Acetoacetate
Step by step
Solved in 2 steps
- (8) B-ketothiolase is a multifunctional enzyme in lipid catabolism. Which of the following is NOT one of its functions? (A) It catalyzes the release of (2) acetyl CoA from acetoacetyl CoA during ketolysis. (B) It removes an acetyl CoA from the fatty acyl chain during B-oxidation. (C) It forms acetoacetate by removing acetyl CoA from HMG CoA during ketogenesis. (D) It condenses (2) acetyl CoA molecules to form acetoacetyl CoA during ketogenesis. (9) What is HMG-COA, in the context of fatty acid catabolism? (A) a product of fatty acid oxidation (B) a ketone body made in liver cells (C) a 6-carbon precursor to the acetoacetate ketone body (D) a 4-carbon precursor to the acetoacetate ketone body (E) a product formed when the B-hydroxybutyrate ketone body is oxidized in brain cells (10) Which of the following symptoms might you expect to see in a patient with defective acyl CoA dehydrogenase under fasting conditions? (A) slowed gluconeogenesis in liver (B) hypoglycemia (C) elevated glycogen…Consider the fatty acids: (a) Arachidic acid (C20H40O2); molar mass = 312.5 g/mol) (b) Palmitoleic acid(C16H30O2); molar mass = 256.4 g/mol). i. How many cycles of β -oxidation are needed for complete oxidation?ii. How many molecules of acetyl CoA are formed from its complete catabolism?iii. Calculate the number of molecules (moles) of ATP formed (net) by the completecatabolism of each fatty acid (show your calculation).iv. Calculate number of moles of ATP formed per gram of each fatty acid metabolized.Which of the following statements about the transamination and deamination steps of amino acid degradation is true? (A) a-ketoglutarate is always formed during a transamination between an amino acid and glutamate. (B) Transamination reactions produce glutamate that is deaminated after entering the urea cycle. (C) Free ammonia is removed from glutamate using glutamate dehydrogenase and NAD+ as an oxidizing agent. (D) The free NH4+ that is removed from glutamate during the deamination reaction is used to form glucose.(E) The carbon backbone that results from transamination enters the mitochondria to be used in the urea cycle.
- To oxidize the fatty acid molecule shown below, what enzyme(s) are needed in addition to the enzymes needed for beta - oxidation? A) 2,4- dienoyl-CoA reductase only B) enoyl-CoA isomerase only C) both enoyl-CoA isomerase and 2,4- dienoyl-CoA reductase D) No additional enzymes are needed besides the normal ones for beta - oxidation. CH3(CH2)3-CH=CH-(CH2)3-C-0° поWhich of the following is a true statement regarding sphingolipid synthesis? (A) The first step in sphingolipid synthesis is the condensation of palmitoyl CoA with aspartate to form b-ketosphinganine.(B) This process requires the reduction of a ketone that uses NADH as the reducing agent.(C) A fatty acid is attached to dihydrosphingosine to form dihydroceramide. (D) FAD is using as an oxidizing agent to remove a double bond from dihydroceramide.(E) The formation of sphingomyelin requires the attachment of a glucose or galactose molecule to ceramide.The following link carbohydrate metabolism with lipid biosynthesis: (a) How many molecules of glucose are required to provide the carbon for synthesis of one molecule of palmitate? (b) How many molecules of glucose are required if all of the glucose first proceeds through the pentose phosphate pathway before proceeding through the rest of glycolysis on its way to pyruvate?
- (i) A patient who is diagnosed with thiamine deficiency exhibited fatigue and muscle cramps. The muscle cramps have been related to an accumulation of pyruvate and a- ketoglutarate. Explain the role of thiamine in this case. (ii) Lipoate is synthesized in human from carbohydrate and amino acids. It does not require a vitamin precursor. In the absence of lipoate, there is reduced production of acetyl-CoA, Provide reasons for this observation.How many acetyl CoA molecules are produced in one cycle of beta oxidation? How many cycles would it take to catabolize a stearic acid molecule (a fatty acid, [18:0]) into acetyl Co A units? a)How many acetyl CoA molecules would be produced? b) How many reduced nucleotides would be produced? c) If a molecule of glucose produces a net 32 ATP when completely catabolized, which do you think will produce more energy, one molecule of glucose or one molecule of stearic acid? Justify your answer.What is the effect on gluconeogenesis and glycogen synthesis of (a) increasing the level of ATP, (b) decreasing the concentration of fructose-1,6- bisphosphate, and (c) increasing the concentration of fructose-6- phosphate?
- The fatty acid 5,8-cis-pentadecanoic acid (CH3-(CH3)5-CH=CH-CH2-CH=CH-(CH2)3-COOH) is subjected to B-oxidation. (a) Indicate the steps involved in its oxidation to acetyl-CoA and/or other products (NADH, FADH2, etc.). (b) What are the products (and quantities) of its complete oxidation (acetyl-CoA, N ADH, FADH2, etc.)? Be sure that you make clear the source of these products.D) Carbohydrate catabolism involves substrate-level phosphorylation. E) My answer is not here 27. The adduct acetoacetyl-acyl carrier protein is formed as an intermediate during fatty acid biosynthesis. The CO2 used to synthesize malonyl-S-CoA is lost. Would this help make the reaction more or less energetically favorable? A) Loss of CO2 increases entropy (AS) and therefore decreases the favorability of the reaction (AG). B) Loss of CO2 has no effect on entropy (AS) and therefore does not affect the favorability of the reaction (AG). C) Loss of CO2 increases entropy (AS) and therefore increases the favorability of the reaction (AG). D) Loss of CO2 decreases entropy (AS) and therefore decreases the favorability of the reaction (AG). E) Loss of CO2 decreases entropy (AS) and therefore increases the favorability of the reaction (AG).(i) Consider a preparation that contains all the enzymes and cofactors necessary for fatty acid biosynthesis from acetyl-CoA and malonyl-CoA. If [2-H] acetyl-CoA labeled with deuterium, the heavy isotope of hydrogen and excess of unlabeled malonyl-CoA are added as substrates, where will you find these labeled deuterium atoms in a molecule of palmitate synthesized? Explain. S-COA (ii) Describe the steps involved in the synthesis of palmitic acid starting from acetyl-CoA and malonyl-CoA.