Match each of the following aspects of triacylglycerols (TAGs) with the main structural feature which makes it possible. You may use each match only once. Ester linkages are vulnerable to hydrolysis. TAGS are not amphipathic. TAGS are hydrophobic and are stored anhydrously. Most of the carbons in TAG are highly reduced. 1. 2. 3. 4. TAGS can produce more energy per carbon than glycogen. TAGS can be stored safely, without danger of dissolving cell membranes. TAGS are a much lighter energy store than an equivalent amount of glycogen. The free fatty acids can be readily liberated from the TAGS when they are required for energy production.

Match each of the following aspects of triacylglycerols (TAGs) with the main structural feature which makes it possible. You may use each match only once. Ester linkages are vulnerable to hydrolysis. TAGS are not amphipathic. TAGS are hydrophobic and are stored anhydrously. Most of the carbons in TAG are highly reduced. 1. 2. 3. 4. TAGS can produce more energy per carbon than glycogen. TAGS can be stored safely, without danger of dissolving cell membranes. TAGS are a much lighter energy store than an equivalent amount of glycogen. The free fatty acids can be readily liberated from the TAGS when they are required for energy production.

Biology Today and Tomorrow without Physiology (MindTap Course List)

5th Edition

ISBN:9781305117396

Author:Cecie Starr, Christine Evers, Lisa Starr

Publisher:Cecie Starr, Christine Evers, Lisa Starr

Chapter2: Molecules Of Life

Section: Chapter Questions

Problem 8SQ: Unlike saturated fatty acids, the tails of unsaturated fatty acids incorporate one or more _______....

See similar textbooks

Similar questions

common and short-hand notation Name the following Fatty Acids using their systematic, ACTIVITY 8.1.1 1. CH3(CH2)5CH=CH(CH2)7COOH 2. CH3(CH2)7CH=CH(CH2)7COOH 3. CH3(CH2)10COOH 4. CH3(CH2)16COOH 5. CH3CH2(CH=CHCH2)3(CH2)6COOH
Draw the skeletal structure of the products formed when the given triacylglycerol is hydrolyzed with water in the presence of sodium hydroxide. You may draw the structures in any arrangement that you like, so long as they aren't touching.
Unsaturated fatty acids are commonly esterified at the hydroxyl substituent of glycerol at what carbon number? 1st carbon 2nd carbon 3rd carbon All carbons
When bonding 1 glycerol molecule, with 3 fatty acid molecules, you can build a tryglceride. In addition to the tryglyceride, can you make any other molecules in the bonding process?
An excess of ketone bodies in the blood causes ketoacidosis. Consider the chemical structure of the ketone bodies (only two out of the three ketone bodies cause this effect) and explain why they are acids.
Amylose is comprised of glucose monomers connected by what kind of glycosidic bond? a (1 -->4) a (1 --> 6) b (1 --> 4) b (1 --> 6) None of the above
Tridecane [CH3(CH2)11CH3] is a major component of the repellent that the stink bug Piezodonis guildinii releases from its scent glands when attacked. What fatty acid gives tridecane on decarboxylation?
Draw the skeletal structure of the products formed when the given triacylglycerol is hydrolyzed with water in the presence of sulfuric acid. You may draw the structures in any arrangement that you like, so long as they aren't touching. O
Sphingolipids can contain of all of the following except O more than one choice O phosphate O Glycerol O a mono- or oligosaccharide Osphingosine.
Oxidation of a thiol produces a disulfide. True or False
Catalytic hydrogenation, used in the food industry, converts double bonds in the fatty acids of the oil triacylglycerols to —CH2— CH2—. How does this affect the physical properties of the oils?
Mild hydrolysis of a glycolipid produces an L-glucose molecule and the salt of tetra-decanoate fatty acid. Draw the structure of the glycolipid.