Concept explainers
Draw all resonance structures of the conjugate bases formed by removal of the labeled protons
a. b.
(a)
Interpretation: The resonance structure of the conjugate bases formed by the removal of the labeled protons
Concept introduction: Most of the organic structures cannot be represented using single Lewis structure. Therefore, there exists more than one Lewis structure for representing a molecule or ion. These structures are known as resonance structures. These are the hypothetical structures and do not specify the exact structure. These resonance structure combine together to give resonance hybrid that is lower in energy and is the most stable structure.
The delocalization of electrons results in the formation resonance structure.
Answer to Problem 19.50P
The resonance structure of the conjugate bases formed by the removal of the labeled protons
Figure 1
The increasing order of acidity of protons is
Explanation of Solution
The given compound is,
Figure 2
The conjugate base formed by the removal of
Figure 3
Therefore, the resonance structure of the conjugate base formed by the removal of the
Figure 4
The conjugate base formed by the removal of
Figure 5
Therefore, the resonance structure of the conjugate base formed by the removal of the
Figure 6
The stability of resonance structures depends upon the following rules:
• The stability of resonance structure is more if it possesses more bonds and fewer charges.
• Resonance structure will be more stable if atoms of the resonance structure have complete octet.
• The stability of resonance structure is more if negative charge is on more electronegative atom
The removal of
Figure 7
Proton acidity depends upon the stability of conjugated bases. More the number of resonance structures more will be the stability of molecule. Therefore, the increasing order of acidity of protons is
The resonance structures of the conjugate bases formed by the removal of the labeled protons
(b)
Interpretation: The resonance structure of the conjugate bases formed by the removal of the labeled protons
Concept introduction: Most of the organic structures cannot be represented using single Lewis structure. Therefore, there exists more than one Lewis structure for representing a molecule or ion. These structures are known as resonance structures. These are the hypothetical structures and do not specify the exact structure. These resonance structure combine together to give resonance hybrid that is lower in energy and is the most stable structure.
The delocalization of electrons results in the formation resonance structure.
Answer to Problem 19.50P
The resonance structure of the conjugate bases formed by the removal of the labeled protons
Figure 8
The increasing order of acidity of protons is
Explanation of Solution
The given compound is,
Figure 9
The conjugate base formed by the removal of
Figure 10
Therefore, the resonance structure of the conjugate base formed by the removal of the
Figure 11
Similarly, the resonance structure of the conjugate base formed by the removal of the
Figure 12
The stability of resonance structures depends upon the following rules:
• The stability of resonance structure is more if it possesses more bonds and fewer charges.
• Resonance structure will be more stable if atoms of the resonance structure have complete octet.
• The stability of resonance structure is more if negative charge is on more electronegative atom
The removal of
Figure 13
Proton acidity depends upon the stability of conjugated bases. More the number of resonance structures more will be the stability of molecule. Therefore, the increasing order of acidity of protons is
The resonance structures of the conjugate bases formed by the removal of the labeled protons
Want to see more full solutions like this?
Chapter 19 Solutions
Organic Chemistry
- Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardIdentify the most and the least acidic compound in each of the following sets. Leave the remaining answer in each set blank. a) 2,4-dinitrobenzoic acid: v p-nitrobenzoic acid: p-bromobenzoic acid: b) benzoic acid: v formic acid: v propanoic acid: c) cyclohexanol: v phenol: v benzoic acid:arrow_forwardRank the indicated a-H’s from most to least acidic (most acidic= 1). Be sure to explain your rankings for each by drawing significant resonance structures for the conjugate base and commenting on any other factors that contribute to your rankings.arrow_forward
- Explain the trends in the acidity of phenol and the monofluoro derivatives of phenol. OH он он он F pк, 10.0 pK, 8.81 pK, 9.28 pK, 9.81arrow_forwardBr NH₂ OH NH₂ CH3 A/RO/exception Circle the more acidic compound and determine the effect responsible for such observation using ARIO methods, or if its an exception to the rule. Please explain thanks.arrow_forwardHow is nucleophilicity (nucleophile strength) related to basicity?arrow_forward
- 4-Cyanophenol has a pKa = 8.0, whereas phenol has a pKa= 10.0. Resonance form that best illustrates why 4-cyanophenol is more acidic isarrow_forward4 5 Arrange the following bases in increasing base strength. There is no partial credit on this problem. Weakest base 1 2 3 Pyridine (C5H5N), Kb = 1.7 x 10-⁹ Aniline (C6H5NH2), Kb = 3.9 x 10-10 Strongest base Methylamine (CH3NH₂), Kb = 4.4 x 10-4 Hydrazine (N2H4), Kb = 1.3 x 10-6 ⠀ Dimethylamine ((CH3)2NH), K₂ = 5.1 x 10-4arrow_forward1. Rank the following species in order of increasing acidity. Explain your reasons for ordering them as you do. HF NH3 H2SO4 CH3OH CH3COOH H3O+ H2O2. Consider the following compounds that vary from nearly nonacidic to strongly acidic. Draw the conjugate bases of these compounds, and explain why the acidity increases so dramatically with substitution by nitro groups. CH4 CH3NO2 CH2(NO2)2 CH(NO2)3arrow_forward
- 1. Explain why the protonation of pyrrole occurs at C2 to form A, rather than the N atom to form B 2. Explain why compound A is more acidic than C, the conjugate acid of pyridine. :N-H H H H -H Pyrrole pKa=0.4 pKa=5.3 A B C Harrow_forwardSelect the stronger base from each pair of compounds.arrow_forwardHow would you describe the reaction between NaOH (a base) and the mixture of benzoic acid and methyl benzoate? Both react with NaOH because bases accept protons Neither react with NaOH because neither has an acidic proton Benzoic acid reacts with NaOH because it has an acidic proton, but methylbenzoate does not Methyl benzoate reacts with NaOH because it has an acidic proton, but benzoic acid does notarrow_forward
- Organic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage LearningOrganic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning