Chemistry for Engineering Students
4th Edition
ISBN: 9781337398909
Author: Lawrence S. Brown, Tom Holme
Publisher: Cengage Learning
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 7, Problem 7.72PAE
7.72 How does an MSN differ from amorphous silica so that is has improved biocompatibility?
Expert Solution & Answer
Trending nowThis is a popular solution!
Students have asked these similar questions
3. The number of Bravais lattices are.
(a) 7.
(b) 14
(c) 10
6. What type of bonding is Potassium likely to participate in? Why?
Given the following thermodynamic data, calculate the lattice energy of LiCl:ΔH°f[LiCl(s)] = -409 kJ/molΔH°sublimation [Li] = 161 kJ/molBond energy [Cl-Cl] = 243 kJ/molIE1 (Li) = 520 kJ/molEA1 (Cl) = -349 kJ/mol
-1682 kJ/mol
-984 kJ/mol
-1560 kJ/mol
-862 kJ/mol
-1213 kJ/mol
Chapter 7 Solutions
Chemistry for Engineering Students
Ch. 7 - List some factors influencing the biocompatibility...Ch. 7 - • use electron configurations to explain why...Ch. 7 - • describe die energy changes in the formation of...Ch. 7 - • define electronegativity and state how...Ch. 7 - • identify or predict polar, nonpolar, and ionic...Ch. 7 - • write Lewis electron structures for molecules or...Ch. 7 - • describe chemical bonding using a model based on...Ch. 7 - • explain how hybridization reconciles observed...Ch. 7 - • predict the geometry of a molecule from its,...Ch. 7 - • use models (real or software) to help visualize...
Ch. 7 - • explain the formation of multiple bonds in terms...Ch. 7 - • identify sigma and pi bonds in a molecule and...Ch. 7 - Define the term biocompatibility.Ch. 7 - List some properties associated with biomaterials...Ch. 7 - Prob. 7.3PAECh. 7 - Prob. 7.4PAECh. 7 - Prob. 7.5PAECh. 7 - Prob. 7.6PAECh. 7 - Why is the ion not found in nature?Ch. 7 - Why do nonmetals tend to form anions rather than...Ch. 7 - Prob. 7.9PAECh. 7 - 7.10 Arrange the members of each of the following...Ch. 7 - 7.11 Arrange the following sets of anions in order...Ch. 7 - 7.12 Which pair will form a compound with the...Ch. 7 - 7.13 Figure 7-2 depicts the interactions of an ion...Ch. 7 - 7.14 Describe the difference between a covalent...Ch. 7 - 7.15 Covalently bonded compounds tend to have much...Ch. 7 - Prob. 7.16PAECh. 7 - 7.17 Coulombic forces are often used to explain...Ch. 7 - 7.18 In terms of the strengths of the covalent...Ch. 7 - 7.19 If the formation of chemical bonds always...Ch. 7 - 7.20 Draw the Lewis dot symbol for each of the...Ch. 7 - 7.21 Theoretical models for the structure of...Ch. 7 - 7.22 Use Lewis dot symbols to explain why chlorine...Ch. 7 - 7.23 Define the term lone pair.Ch. 7 - 7.24 How many electrons are shared between two...Ch. 7 - 7.25 How does the bond energy of a double bond...Ch. 7 - 7.26 How is electronegativity defined?Ch. 7 - 7.27 Distinguish between electron affinity and...Ch. 7 - 7.28 Certain elements in the periodic table shown...Ch. 7 - 7.29 When two atoms with different...Ch. 7 - 7.30 The bond in HF is said to be polar, with the...Ch. 7 - 7.31 Why is a bond between two atoms with...Ch. 7 - Prob. 7.32PAECh. 7 - 7.33 In each group of three bonds, which bond is...Ch. 7 - Prob. 7.34PAECh. 7 - 7.35 Which one of the following contains botb...Ch. 7 - Prob. 7.36PAECh. 7 - 7.37 Draw the Lewis structure for each of the...Ch. 7 - 7.38 Draw a Lewis structure for each of the...Ch. 7 - Prob. 7.39PAECh. 7 - 7.40 Why is it impossible for hydrogen to be the...Ch. 7 - Prob. 7.41PAECh. 7 - 7.42 Draw resonance structure for (a) (b) and (c)Ch. 7 - Prob. 7.43PAECh. 7 - Prob. 7.44PAECh. 7 - Prob. 7.45PAECh. 7 - 7.46 Consider the nitrogen-oxygen bond lengths in...Ch. 7 - 7.47 Which of the species listed has a Lewis...Ch. 7 - 7.48 Identify what is incorrect in the Lewis...Ch. 7 - 7.49 Identify what is incorrect in the Lewis...Ch. 7 - 7.50 Chemical species are said to be isoelectronic...Ch. 7 - 7.51 Explain the concept of wave interference in...Ch. 7 - 7.52 How does orbital overlap explain the buildup...Ch. 7 - 7.53 How do sigma and pi bonds differ? How are...Ch. 7 - 7.54 CO , CO2 , CH3OH , and CO32 , all contain...Ch. 7 - 7.55 Draw the Lewis dot structure of the following...Ch. 7 - 7.56 Draw the Lewis dot structures of the...Ch. 7 - 7.57 What observation about molecules compels us...Ch. 7 - Prob. 7.58PAECh. 7 - 7.59 What type of hybrid orbital is generated by...Ch. 7 - 7.60 What type of hybridization would be expected...Ch. 7 - 7.61 What hybrid orbitals would be expected for...Ch. 7 - 7.62 What type of hybridization would you expect...Ch. 7 - 7.63 What physical concept forms the premise of...Ch. 7 - 7.64 Predict the geometry of the following...Ch. 7 - Prob. 7.65PAECh. 7 - Prob. 7.66PAECh. 7 - Prob. 7.67PAECh. 7 - 7.68 Give approximate values for the indicated...Ch. 7 - 7.69 Propene has the chemical formula Describe the...Ch. 7 - Prob. 7.70PAECh. 7 - Prob. 7.71PAECh. 7 - 7.72 How does an MSN differ from amorphous silica...Ch. 7 - Prob. 7.73PAECh. 7 - 7.74 In a lattice, a positive ion is often...Ch. 7 - 7.75 Use the concept of lattice energy to...Ch. 7 - Prob. 7.76PAECh. 7 - Prob. 7.77PAECh. 7 - Prob. 7.78PAECh. 7 - Prob. 7.79PAECh. 7 - Prob. 7.80PAECh. 7 - Prob. 7.81PAECh. 7 - Prob. 7.82PAECh. 7 - Prob. 7.83PAECh. 7 - 7.84 Which of the following molecules is least...Ch. 7 - 7.85 Consider the molecule whose structure is...Ch. 7 - 7.86 Nitrogen triiodide, NI3(s) , is unstable and...Ch. 7 - 7.87 Nitrogen is capable of forming single,...Ch. 7 - 7.88 The N5+ cation has been synthesized and...Ch. 7 - Prob. 7.89PAECh. 7 - Prob. 7.90PAECh. 7 - 7.91 A Lewis structure for the oxalate ion is...Ch. 7 - Prob. 7.92PAECh. 7 - 7.93 An unknown metal M forms a chloride with the...Ch. 7 - Prob. 7.94PAECh. 7 - Prob. 7.95PAECh. 7 - 7.96 Consider the hydrocarbons whose structures...Ch. 7 - 7.97 Consider the structure shown below for as...Ch. 7 - Prob. 7.98PAECh. 7 - Prob. 7.99PAECh. 7 - Prob. 7.100PAECh. 7 - 7.101 Lead selenide nanocrystals may provide a...Ch. 7 - Prob. 7.102PAECh. 7 - Prob. 7.103PAECh. 7 - 7.104 Hydrogen azide, HN3 , is a liquid that...Ch. 7 - Prob. 7.105PAECh. 7 - Prob. 7.106PAECh. 7 - 7.107 How do the Lewis symbols for C, Si, and Ge...Ch. 7 - Prob. 7.108PAECh. 7 - Prob. 7.109PAE
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Although nitrogen trifluoride (NF3) is a thermally stable compound, nitrogen triiodide (Nl3) is known to be a highly explosive material. NI3 can be synthesized according to the equation BN(s)+3IF(g)BF3(g)+NI3(g) a. What is the enthalpy of formation for NI3(s) given the enthalpy of reaction ( 307 kJ) and the enthalpies of formation for BN(s) (254 kJ/mol), IF(g) ( 96 kJ/mol), and BF3(g) ( 1136 kJ/mol)? b. It is reported that when the synthesis of NI3 is conducted using 4 moles of IF for every l mole of BN. one of the by-products isolated is [IF2]+ [BF4]. What are the molecular geometries of the species in this by-product? What are the hybridizations of the central atoms in each species in the by-product?arrow_forwardTo explain why AHan for RbCl is different than that for KCI, the student investigates factors that affect AHoln and finds that ionic radius and lattice enthalpy (which can be defined as the AH associated with the separation of a solid crystal into gaseous ions) contribute to the process. The students consults references and collects the data shown in the table below. lonic Radius (pm) lon к' 138 Rb* 152 b. Using principles of atomic structure, explain why the Rb' ion is larger than the K' ionarrow_forwardCHAPTER 8 - BONDING AND MOLECULAR STRUCTURE Previous Page 15 of 16 Next O References Use the References to access important values if needed for this question. The length of a covalent bond depends upon the size of the atoms and the bond order. For each pair of covalently bonded atoms, choose the one expected to have the shortest bond length. (A) P-Br (B) C-Br (A.B) (C) P-I (D) P-CI (C.D) Type here to search FLVarrow_forward
- Calculate the lattice energy of magnesium sulfide from the data given below. Mg(s) Mg(g) AE 148 kJ/mol Mg2g) 8S(g) AE 2232 kJ/mol 2e AE 2186 kJ/mol Mg(g) S8(s) Sig) 2eSg) AE= 450 kJ/mol 8Mg(s)S8(s) -» 8M9S(s) AE = -2744 kJ/mol Mg2+(g) S2g) MgS(s) AElattice = ?arrow_forwardOf the elements Be, C, Cl, Sb, and Cs, which is most likely to participate in extensive p bonding,?arrow_forwardIn XCI, which crystallizes in CSCI structure, the sum of the anionic and cationic radii is found to be 318 pm. The density of the compound is 7.799 g cm. Calculate the mass of the cation as g mol. Do not write units, only enter numerical values. Use two digits at most for decimal numbers, use dot (.) as decimal separator (i.e. two-point-fifty-one should be entered as 2.51). Do not use comma (,) as decimal separator.arrow_forward
- Calcul. X (83,89 X E Whe What n/takeAssignment/takeCovalentActivity.do?locator=Dassignment-take [Review Topics] [References Use the References to access important values if needed for tE The following Lewis diagram represents the valence electron configuration of a main-group element. This element is in group According to the octet rule, this element would be expected to form an ion with a charge of If X is in period 4, the ion formed has the same electron configuration as the noble gas The symbol for the ion is Submit Answer Retry Entire Group 8 more group attempts remaining Cengage Learning Cengage Technical Supportarrow_forward1. I. How is metallic bonding formed? II. Explain why metallic bonding strength decrease down the group. Eg. Li>Na>K>Rb>Csarrow_forward• draw and label an atomic/molecular level depiction that explains the observedproperties below.• Then use the drawing to explain how the type of bonding in the element leads to itsobserved properties. 1) Bromine: Br2, mp 266 K, brown liquid, easily vaporized (bp 332 K). At temperatures above 1000K, Br2 dissociates.arrow_forward
- Using the standard enthalpy of formation data in Appendix G, determine which bond is stronger: the SF bond in SF4(g) or in SF6(g)?arrow_forward7.84 Which of the following molecules is least likely to actually exist OF4,SF4,SeF4 , or TeF4 ? Why?arrow_forwardhy is the molecular structure of H2Ononlinear, whereas that of BeF2is linear, even though both molecules consist of three atoms?arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co
- Principles of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry: Matter and Change
Chemistry
ISBN:9780078746376
Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom
Publisher:Glencoe/McGraw-Hill School Pub Co
Principles of Modern Chemistry
Chemistry
ISBN:9781305079113
Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler
Publisher:Cengage Learning
Chemistry: The Molecular Science
Chemistry
ISBN:9781285199047
Author:John W. Moore, Conrad L. Stanitski
Publisher:Cengage Learning
Chemistry by OpenStax (2015-05-04)
Chemistry
ISBN:9781938168390
Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher:OpenStax
NEET Chemistry | Group 14 Carbon Family | Theory & Problem Solving | In English | Misostudy; Author: Misostudy;https://www.youtube.com/watch?v=enOGIrcHh54;License: Standard YouTube License, CC-BY