Interpretation: The mechanism of the reaction in which methanol acts as nucleophile rather than a base in the formation of cyclohexene is to be represented.
Concept introduction: The elimination reaction is the organic reaction in which two substituents are removed from the organic molecule in one step or two steps. The two mechanisms of the elimination reaction are E1 and E2 mechanism.
In E2 mechanism, the elimination takes place in one step.
The dehydrohalogenation reaction of the organic compound results in the formation of
To determine: The mechanism of the reaction in which methanol acts as nucleophile rather than a base in the formation of cyclohexene.
Want to see the full answer?
Check out a sample textbook solutionChapter 7 Solutions
Organic Chemistry (9th Edition)
- For each molecule below, draw the conjugate acid or conjugate base or both if the molecule hasboth a conjugate acid and a conjugate base (e.g., water).arrow_forwardComplete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardHighlight in red each acidic location on the organic molecule at left. Highlight in blue each basic location on the organic molecule at right. Note for advanced students: we mean acidic or basic in the Brønsted-Lowry sense only. OH OH Xarrow_forward
- For the following reaction, mark the nucleophile, the electrophile and leaving group.arrow_forwardFor the reaction below identify the reactant electrophile and the nucleophile.arrow_forwardDraw the product & reaction arrows for each of the following acid-base reactions for the following. Which side of the equilibrium will be favored in both reactions?arrow_forward
- Is this a base or a nucleophilearrow_forwardLet's say we had an acid-base reaction of acetic acid and hydronium. What would the products be? Where would the positive charge be for the acetic acid's conjugate acid? Why would the hydrogen add to the oxygen that is double bonded instead of the oxygen that is single bonded (on acetic acid)?arrow_forwardIdentify the electrophile and the nucleophile in each of the following reaction steps. Then draw curved arrows to illustrate the bond-making and bond-breaking processes.arrow_forward
- 7. (Chapters 6 and 8) Within the following set, which is more stable, and why? CH3 CH3 H3C- -C=CH- CH2 H2C=Ć- -CH CH3 8. (Chapter 12) What type of instability will an intermediate need to address following the reaction of a nucleophile/base that has a negative charge with a pi bond that has uneven electron distribution between atoms with different electronegativities (C=O)? 9. (Chapter 9) Circle the carbon that will be unstable in the intermediate of the following reaction. Then, state the reason for your choice, and also indicate what type of instability it will be. H,C-CH,- C ECH with NaNH2 10. (Chapters 12 and 13) What are three sources used to provide electrons to an electron-deficient carbon with a leaving group? 1. 2. 3.arrow_forwardSelect the best reagent to complete the job. You may assume a separate protonation step where relevant.arrow_forwardThe SN2 reaction shows a reversible mechanism when the basic strength nucleophile and leaving group are similar, but not when the strength of the nucleophile as a base is greater than that of the leaving group. Explain.arrow_forward
- Organic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage LearningOrganic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning